12,12-Dimethyl-6-propan-2-yltricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7-tetraen-5-ol
| Internal ID | 34f244dc-9d8c-4ee3-a8af-52349033d7cd |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
| IUPAC Name | 12,12-dimethyl-6-propan-2-yltricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7-tetraen-5-ol |
| SMILES (Canonical) | CC(C)C1=C(C=C2CC3=CCCC(C3CCC2=C1)(C)C)O |
| SMILES (Isomeric) | CC(C)C1=C(C=C2CC3=CCCC(C3CCC2=C1)(C)C)O |
| InChI | InChI=1S/C20H28O/c1-13(2)17-11-14-7-8-18-15(6-5-9-20(18,3)4)10-16(14)12-19(17)21/h6,11-13,18,21H,5,7-10H2,1-4H3 |
| InChI Key | GSLVTONCLQJXSA-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C20H28O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.214015512 g/mol |
| Topological Polar Surface Area (TPSA) | 20.20 Ų |
| XlogP | 5.70 |
| There are no found synonyms. |
![2D Structure of 12,12-Dimethyl-6-propan-2-yltricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7-tetraen-5-ol](https://plantaedb.com/storage/docs/compounds/2023/11/1212-dimethyl-6-propan-2-yltricyclo940038pentadeca-115357-tetraen-5-ol.jpg "2D Structure of 12,12-Dimethyl-6-propan-2-yltricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7-tetraen-5-ol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.39% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.68% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.56% | 94.45% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.57% | 97.25% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.69% | 99.15% |
| CHEMBL2581 | P07339 | Cathepsin D | 88.56% | 98.95% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.86% | 95.89% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.85% | 90.71% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.31% | 100.00% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 87.21% | 93.40% |
| CHEMBL4444 | P04070 | Vitamin K-dependent protein C | 87.04% | 93.89% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.68% | 97.09% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 86.34% | 91.79% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 85.79% | 90.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.49% | 95.56% |
| CHEMBL3038469 | P24941 | CDK2/Cyclin A | 85.00% | 91.38% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 84.98% | 96.77% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 84.74% | 99.18% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 84.67% | 91.03% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 84.08% | 96.21% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 83.70% | 82.69% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.41% | 92.94% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 81.38% | 93.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Chamaecyparis formosensis |
| Chamaecyparis pisifera |
| Salvia przewalskii |
| PubChem | 11011523 |
| LOTUS | LTS0165680 |
| wikiData | Q105017304 |