1,2,10-trimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-3,11-diol
Internal ID | 2ed7ebd7-ada0-450f-bda5-a4a2fc143781 |
Taxonomy | Alkaloids and derivatives > Aporphines |
IUPAC Name | 1,2,10-trimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-3,11-diol |
SMILES (Canonical) | CN1CCC2=C3C1CC4=C(C3=C(C(=C2O)OC)OC)C(=C(C=C4)OC)O |
SMILES (Isomeric) | CN1CCC2=C3C1CC4=C(C3=C(C(=C2O)OC)OC)C(=C(C=C4)OC)O |
InChI | InChI=1S/C20H23NO5/c1-21-8-7-11-15-12(21)9-10-5-6-13(24-2)18(23)14(10)16(15)19(25-3)20(26-4)17(11)22/h5-6,12,22-23H,7-9H2,1-4H3 |
InChI Key | ZLDNXEZNXWTKLG-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H23NO5 |
Molecular Weight | 357.40 g/mol |
Exact Mass | 357.15762283 g/mol |
Topological Polar Surface Area (TPSA) | 71.40 Ų |
XlogP | 2.20 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.01% | 96.09% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 97.05% | 95.62% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 94.89% | 91.49% |
CHEMBL2056 | P21728 | Dopamine D1 receptor | 94.30% | 91.00% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 93.98% | 93.99% |
CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 92.01% | 91.79% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.42% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 89.69% | 98.95% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.78% | 95.89% |
CHEMBL4208 | P20618 | Proteasome component C5 | 88.59% | 90.00% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 88.37% | 89.62% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.27% | 91.11% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 85.70% | 91.03% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.51% | 86.33% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 85.08% | 93.40% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.86% | 95.89% |
CHEMBL3438 | Q05513 | Protein kinase C zeta | 80.70% | 88.48% |
CHEMBL2535 | P11166 | Glucose transporter | 80.60% | 98.75% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.26% | 85.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Thalictrum pedunculatum |
Thalictrum urbaini |
PubChem | 14378683 |
LOTUS | LTS0116815 |
wikiData | Q105378852 |