12-Methyltetradecanoic acid
| Internal ID | 6c7a5f53-1989-47df-8f69-09d227e19e74 |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty acids and conjugates > Long-chain fatty acids |
| IUPAC Name | 12-methyltetradecanoic acid |
| SMILES (Canonical) | CCC(C)CCCCCCCCCCC(=O)O |
| SMILES (Isomeric) | CCC(C)CCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C15H30O2/c1-3-14(2)12-10-8-6-4-5-7-9-11-13-15(16)17/h14H,3-13H2,1-2H3,(H,16,17) |
| InChI Key | XKLJLHAPJBUBNL-UHFFFAOYSA-N |
| Popularity | 170 references in papers |
| Molecular Formula | C15H30O2 |
| Molecular Weight | 242.40 g/mol |
| Exact Mass | 242.224580195 g/mol |
| Topological Polar Surface Area (TPSA) | 37.30 Ų |
| XlogP | 5.50 |
| 5502-94-3 |
| Sarcinic acid |
| Aseanostatin P5 |
| ANTEISOPENTADECANOIC ACID |
| 12-methyl myristic acid |
| 12-methyl-tetradecanoic acid |
| methyl myristic acid |
| 12-MTA |
| anteiso-C15:0 |
| Tetradecanoic acid, 12-methyl- |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.21% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.69% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.17% | 99.17% |
| CHEMBL5285 | Q99683 | Mitogen-activated protein kinase kinase kinase 5 | 92.21% | 92.26% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 87.86% | 100.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 87.52% | 93.56% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 83.88% | 96.47% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 82.86% | 90.17% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.52% | 90.71% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 81.32% | 97.29% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 80.73% | 97.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Antirrhinum majus |
| Solanum lycopersicum |
| PubChem | 21672 |
| LOTUS | LTS0191805 |
| wikiData | Q27119789 |