12-methoxy-8H-benzo[g][1,3]benzodioxolo[6,5,4-de]quinolin-8-one
Internal ID | e5a4d0be-171a-483e-873f-f56fd9c03d46 |
Taxonomy | Alkaloids and derivatives > Aporphines |
IUPAC Name | 18-methoxy-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,9,11,14(19),15,17-octaen-13-one |
SMILES (Canonical) | COC1=CC=CC2=C1C3=C4C(=CC5=C3OCO5)C=CN=C4C2=O |
SMILES (Isomeric) | COC1=CC=CC2=C1C3=C4C(=CC5=C3OCO5)C=CN=C4C2=O |
InChI | InChI=1S/C18H11NO4/c1-21-11-4-2-3-10-14(11)15-13-9(5-6-19-16(13)17(10)20)7-12-18(15)23-8-22-12/h2-7H,8H2,1H3 |
InChI Key | LENYISKFJJQKGE-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C18H11NO4 |
Molecular Weight | 305.30 g/mol |
Exact Mass | 305.06880783 g/mol |
Topological Polar Surface Area (TPSA) | 57.60 Ų |
XlogP | 3.40 |
Atomic LogP (AlogP) | 3.18 |
H-Bond Acceptor | 5 |
H-Bond Donor | 0 |
Rotatable Bonds | 1 |
8H-benzo[g]-1,3-benzodioxolo[6,5,4-de]quinolin-8-one, 12-methoxy- |
InChI=1/C18H11NO4/c1-21-11-4-2-3-10-14(11)15-13-9(5-6-19-16(13)17(10)20)7-12-18(15)23-8-22-12/h2-7H,8H2,1H |
![2D Structure of 12-methoxy-8H-benzo[g][1,3]benzodioxolo[6,5,4-de]quinolin-8-one 2D Structure of 12-methoxy-8H-benzo[g][1,3]benzodioxolo[6,5,4-de]quinolin-8-one](https://plantaedb.com/storage/docs/compounds/2023/11/12-methoxy-8h-benzog13benzodioxolo654-dequinolin-8-one.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9935 | 99.35% |
Caco-2 | + | 0.8011 | 80.11% |
Blood Brain Barrier | + | 0.6250 | 62.50% |
Human oral bioavailability | - | 0.5000 | 50.00% |
Subcellular localzation | Mitochondria | 0.6511 | 65.11% |
OATP2B1 inhibitior | - | 0.8558 | 85.58% |
OATP1B1 inhibitior | + | 0.9543 | 95.43% |
OATP1B3 inhibitior | + | 0.9647 | 96.47% |
MATE1 inhibitior | - | 0.8200 | 82.00% |
OCT2 inhibitior | - | 1.0000 | 100.00% |
BSEP inhibitior | + | 0.8029 | 80.29% |
P-glycoprotein inhibitior | - | 0.7245 | 72.45% |
P-glycoprotein substrate | - | 0.7156 | 71.56% |
CYP3A4 substrate | + | 0.6081 | 60.81% |
CYP2C9 substrate | - | 1.0000 | 100.00% |
CYP2D6 substrate | - | 0.7812 | 78.12% |
CYP3A4 inhibition | + | 0.9173 | 91.73% |
CYP2C9 inhibition | + | 0.5571 | 55.71% |
CYP2C19 inhibition | + | 0.8011 | 80.11% |
CYP2D6 inhibition | - | 0.5634 | 56.34% |
CYP1A2 inhibition | + | 0.9571 | 95.71% |
CYP2C8 inhibition | + | 0.5665 | 56.65% |
CYP inhibitory promiscuity | + | 0.9186 | 91.86% |
UGT catelyzed | - | 0.0000 | 0.00% |
Carcinogenicity (binary) | - | 0.9900 | 99.00% |
Carcinogenicity (trinary) | Non-required | 0.5056 | 50.56% |
Eye corrosion | - | 0.9832 | 98.32% |
Eye irritation | - | 0.5160 | 51.60% |
Skin irritation | - | 0.7758 | 77.58% |
Skin corrosion | - | 0.9633 | 96.33% |
Ames mutagenesis | + | 0.8100 | 81.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.4915 | 49.15% |
Micronuclear | + | 0.7374 | 73.74% |
Hepatotoxicity | + | 0.7000 | 70.00% |
skin sensitisation | - | 0.7997 | 79.97% |
Respiratory toxicity | + | 0.7444 | 74.44% |
Reproductive toxicity | + | 0.7667 | 76.67% |
Mitochondrial toxicity | + | 0.5875 | 58.75% |
Nephrotoxicity | + | 0.8074 | 80.74% |
Acute Oral Toxicity (c) | III | 0.7621 | 76.21% |
Estrogen receptor binding | + | 0.8962 | 89.62% |
Androgen receptor binding | + | 0.6075 | 60.75% |
Thyroid receptor binding | + | 0.7045 | 70.45% |
Glucocorticoid receptor binding | + | 0.9050 | 90.50% |
Aromatase binding | + | 0.6771 | 67.71% |
PPAR gamma | + | 0.7531 | 75.31% |
Honey bee toxicity | - | 0.8114 | 81.14% |
Biodegradation | - | 0.9000 | 90.00% |
Crustacea aquatic toxicity | - | 0.5300 | 53.00% |
Fish aquatic toxicity | - | 0.5083 | 50.83% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 96.79% | 94.00% |
CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 96.72% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.94% | 86.33% |
CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 95.15% | 94.03% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 94.94% | 96.77% |
CHEMBL2581 | P07339 | Cathepsin D | 94.02% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.98% | 89.00% |
CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 93.97% | 96.67% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 93.20% | 96.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.36% | 96.09% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 92.19% | 99.23% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 92.13% | 96.00% |
CHEMBL2535 | P11166 | Glucose transporter | 91.22% | 98.75% |
CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 91.21% | 82.67% |
CHEMBL5747 | Q92793 | CREB-binding protein | 90.93% | 95.12% |
CHEMBL5203 | P33316 | dUTP pyrophosphatase | 89.89% | 99.18% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 89.38% | 94.80% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.58% | 85.14% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.47% | 95.56% |
CHEMBL3116 | P50750 | Cyclin-dependent kinase 9 | 88.28% | 96.31% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 87.69% | 92.62% |
CHEMBL5925 | P22413 | Ectonucleotide pyrophosphatase/phosphodiesterase family member 1 | 87.60% | 92.38% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.36% | 91.11% |
CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 84.54% | 100.00% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 83.40% | 94.75% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 82.90% | 100.00% |
CHEMBL5014 | O43353 | Serine/threonine-protein kinase RIPK2 | 82.67% | 86.79% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.46% | 95.89% |
CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 82.44% | 96.39% |
CHEMBL2047 | Q96RI1 | Bile acid receptor FXR | 82.14% | 96.10% |
CHEMBL1907598 | P05106 | Integrin alpha-V/beta-3 | 82.05% | 95.71% |
CHEMBL4225 | P49760 | Dual specificity protein kinase CLK2 | 81.21% | 80.96% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 80.21% | 96.38% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Duguetia eximia |
Guatteria maypurensis |
Laurelia novae-zelandiae |
Mitrephora maingayi |
Mitrephora tomentosa |
Mitrephora vulpina |
Stephania excentrica |
PubChem | 639590 |
LOTUS | LTS0240260 |
wikiData | Q104398862 |