12-Methoxy-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-6-one
| Internal ID | 440450c4-d86a-46c9-ae26-8223c162ab08 |
| Taxonomy | Alkaloids and derivatives > Lupin alkaloids > Sparteine, lupanine, and related alkaloids |
| IUPAC Name | 12-methoxy-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-6-one |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C16H26N2O2/c1-20-13-5-6-17-9-11-7-12(15(17)8-13)10-18-14(11)3-2-4-16(18)19/h11-15H,2-10H2,1H3 |
| InChI Key | NFCKZRHDRGPCSU-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.199428076 g/mol |
| Topological Polar Surface Area (TPSA) | 32.80 Ų |
| XlogP | 1.10 |
| There are no found synonyms. |
![2D Structure of 12-Methoxy-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-6-one](https://plantaedb.com/storage/docs/compounds/2023/11/12-methoxy-715-diazatetracyclo77102701015heptadecan-6-one.jpg "2D Structure of 12-Methoxy-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-6-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.25% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.60% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.57% | 98.95% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.70% | 97.25% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.91% | 95.56% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.84% | 95.89% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 87.67% | 97.05% |
| CHEMBL264 | Q9Y5N1 | Histamine H3 receptor | 87.16% | 91.43% |
| CHEMBL4235 | P28845 | 11-beta-hydroxysteroid dehydrogenase 1 | 86.55% | 97.98% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.54% | 97.09% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 86.40% | 94.66% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.21% | 94.45% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.92% | 92.94% |
| CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 83.74% | 94.78% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.26% | 92.50% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 82.83% | 91.81% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 81.91% | 93.03% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 81.79% | 91.49% |
| CHEMBL3820 | P35557 | Hexokinase type IV | 81.66% | 91.96% |
| CHEMBL1871 | P10275 | Androgen Receptor | 81.43% | 96.43% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 81.39% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Lupinus polyphyllus |
| PubChem | 53462814 |
| LOTUS | LTS0133182 |
| wikiData | Q105178373 |