12-(Hydroxymethyl)-6,9-dimethyl-3-propan-2-yltetracyclo[7.5.0.02,6.012,14]tetradecane-7,11-diol
| Internal ID | 2de55ff6-d46f-4874-b72e-2056b0fa1782 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
| IUPAC Name | 12-(hydroxymethyl)-6,9-dimethyl-3-propan-2-yltetracyclo[7.5.0.02,6.012,14]tetradecane-7,11-diol |
| SMILES (Canonical) | CC(C)C1CCC2(C1C3C4CC4(C(CC3(CC2O)C)O)CO)C |
| SMILES (Isomeric) | CC(C)C1CCC2(C1C3C4CC4(C(CC3(CC2O)C)O)CO)C |
| InChI | InChI=1S/C20H34O3/c1-11(2)12-5-6-19(4)14(22)8-18(3)9-15(23)20(10-21)7-13(20)17(18)16(12)19/h11-17,21-23H,5-10H2,1-4H3 |
| InChI Key | JAYDSYVXWHKZDH-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H34O3 |
| Molecular Weight | 322.50 g/mol |
| Exact Mass | 322.25079494 g/mol |
| Topological Polar Surface Area (TPSA) | 60.70 Ų |
| XlogP | 3.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.32% | 96.09% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 96.02% | 90.17% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 95.67% | 96.38% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.76% | 97.25% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 92.63% | 98.10% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 92.52% | 96.61% |
| CHEMBL204 | P00734 | Thrombin | 91.79% | 96.01% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 90.85% | 94.75% |
| CHEMBL1871 | P10275 | Androgen Receptor | 89.61% | 96.43% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 88.73% | 95.93% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.23% | 100.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.19% | 97.09% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 85.79% | 92.86% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 85.76% | 97.47% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.41% | 95.89% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.35% | 94.45% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 84.83% | 97.79% |
| CHEMBL2815 | P04629 | Nerve growth factor receptor Trk-A | 83.36% | 87.16% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.21% | 95.89% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 83.00% | 98.03% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 82.79% | 96.77% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.64% | 100.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 81.41% | 91.11% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.91% | 96.95% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 80.75% | 95.50% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 80.52% | 96.47% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 80.13% | 98.05% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 80.04% | 82.69% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 73837690 |
| LOTUS | LTS0154802 |
| wikiData | Q104169348 |