12-Ethylidene-8,14-diazapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6-triene-10-carbaldehyde
Internal ID | 6c6689a9-3410-42fe-b815-f466bf4fc972 |
Taxonomy | Alkaloids and derivatives > Strychnos alkaloids |
IUPAC Name | 12-ethylidene-8,14-diazapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6-triene-10-carbaldehyde |
SMILES (Canonical) | CC=C1CN2CCC34C2CC1C(C3NC5=CC=CC=C45)C=O |
SMILES (Isomeric) | CC=C1CN2CCC34C2CC1C(C3NC5=CC=CC=C45)C=O |
InChI | InChI=1S/C19H22N2O/c1-2-12-10-21-8-7-19-15-5-3-4-6-16(15)20-18(19)14(11-22)13(12)9-17(19)21/h2-6,11,13-14,17-18,20H,7-10H2,1H3 |
InChI Key | GOUXXPLYMIUQLE-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C19H22N2O |
Molecular Weight | 294.40 g/mol |
Exact Mass | 294.173213330 g/mol |
Topological Polar Surface Area (TPSA) | 32.30 Ų |
XlogP | 2.00 |
There are no found synonyms. |
![2D Structure of 12-Ethylidene-8,14-diazapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6-triene-10-carbaldehyde 2D Structure of 12-Ethylidene-8,14-diazapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6-triene-10-carbaldehyde](https://plantaedb.com/storage/docs/compounds/2023/11/12-ethylidene-814-diazapentacyclo95201902701417octadeca-246-triene-10-carbaldehyde.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.86% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.74% | 95.56% |
CHEMBL284 | P27487 | Dipeptidyl peptidase IV | 93.54% | 95.69% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.80% | 97.09% |
CHEMBL2581 | P07339 | Cathepsin D | 88.82% | 98.95% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 86.15% | 97.25% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.85% | 94.45% |
CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 82.32% | 82.38% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.31% | 90.00% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 82.27% | 91.11% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 82.26% | 82.69% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 82.18% | 94.62% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 82.16% | 95.83% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 81.64% | 100.00% |
CHEMBL5028 | O14672 | ADAM10 | 81.03% | 97.50% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.58% | 100.00% |
CHEMBL238 | Q01959 | Dopamine transporter | 80.38% | 95.88% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 80.16% | 90.24% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Strychnos matopensis |
PubChem | 24072520 |
LOTUS | LTS0217161 |
wikiData | Q105014604 |