12-Ethenyl-1,7,7,12-tetramethyl-5-oxatricyclo[8.4.0.02,6]tetradec-2-en-4-one
Internal ID | ce5f3d8a-947c-4498-81fb-30c931a141cb |
Taxonomy | Organoheterocyclic compounds > Dihydrofurans > Furanones > Butenolides |
IUPAC Name | 12-ethenyl-1,7,7,12-tetramethyl-5-oxatricyclo[8.4.0.02,6]tetradec-2-en-4-one |
SMILES (Canonical) | CC1(CCC2CC(CCC2(C3=CC(=O)OC31)C)(C)C=C)C |
SMILES (Isomeric) | CC1(CCC2CC(CCC2(C3=CC(=O)OC31)C)(C)C=C)C |
InChI | InChI=1S/C19H28O2/c1-6-18(4)9-10-19(5)13(12-18)7-8-17(2,3)16-14(19)11-15(20)21-16/h6,11,13,16H,1,7-10,12H2,2-5H3 |
InChI Key | HJTIEBXNTWYKEY-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C19H28O2 |
Molecular Weight | 288.40 g/mol |
Exact Mass | 288.208930132 g/mol |
Topological Polar Surface Area (TPSA) | 26.30 Ų |
XlogP | 5.40 |
12-ethenyl-1,7,7,12-tetramethyl-5-oxatricyclo[8.4.0.0?,?]tetradec-2-en-4-one |
(1R,6R,10R,12R)-12-ethenyl-1,7,7,12-tetramethyl-5-oxatricyclo[8.4.0.0^{2,6]tetradec-2-en-4-one |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.45% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.94% | 95.56% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.75% | 100.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.95% | 97.09% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 86.88% | 93.40% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 83.63% | 96.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.35% | 95.89% |
CHEMBL1871 | P10275 | Androgen Receptor | 83.07% | 96.43% |
CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 82.87% | 94.66% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 82.17% | 94.80% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 81.42% | 94.75% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 81.32% | 97.25% |
CHEMBL4530 | P00488 | Coagulation factor XIII | 81.08% | 96.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.31% | 94.45% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.24% | 89.00% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 80.11% | 93.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Euphorbia fischeri |
PubChem | 85248818 |
LOTUS | LTS0123332 |
wikiData | Q105029441 |