1,2-Dihydroxy-5,6-dimethoxyxanthen-9-one
| Internal ID | da571b7b-5c60-4efa-9fa5-e14b95547724 |
| Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Xanthones |
| IUPAC Name | 1,2-dihydroxy-5,6-dimethoxyxanthen-9-one |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C15H12O6/c1-19-10-5-3-7-12(17)11-9(6-4-8(16)13(11)18)21-14(7)15(10)20-2/h3-6,16,18H,1-2H3 |
| InChI Key | LZLVACAUDLBOKV-UHFFFAOYSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C15H12O6 |
| Molecular Weight | 288.25 g/mol |
| Exact Mass | 288.06338810 g/mol |
| Topological Polar Surface Area (TPSA) | 85.20 Ų |
| XlogP | 2.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.98% | 91.11% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.22% | 94.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.27% | 94.45% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.00% | 95.56% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 93.78% | 91.49% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.60% | 89.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 91.50% | 99.23% |
| CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 89.79% | 80.78% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 88.16% | 90.20% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 87.48% | 93.99% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.66% | 86.33% |
| CHEMBL2535 | P11166 | Glucose transporter | 85.08% | 98.75% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.82% | 99.15% |
| CHEMBL3194 | P02766 | Transthyretin | 83.82% | 90.71% |
| CHEMBL2581 | P07339 | Cathepsin D | 83.11% | 98.95% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 81.97% | 98.11% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 80.22% | 93.65% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Garcinia subelliptica |
| PubChem | 10016947 |
| LOTUS | LTS0023538 |
| wikiData | Q105159979 |