1,2-Dihydroxy-3-methoxy-10-methyl-9-acridone
| Internal ID | ef6ebf8e-bf58-478e-8a5b-def42d8670a7 |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Benzoquinolines > Acridines > Acridones |
| IUPAC Name | 1,2-dihydroxy-3-methoxy-10-methylacridin-9-one |
| SMILES (Canonical) | CN1C2=CC=CC=C2C(=O)C3=C(C(=C(C=C31)OC)O)O |
| SMILES (Isomeric) | CN1C2=CC=CC=C2C(=O)C3=C(C(=C(C=C31)OC)O)O |
| InChI | InChI=1S/C15H13NO4/c1-16-9-6-4-3-5-8(9)13(17)12-10(16)7-11(20-2)14(18)15(12)19/h3-7,18-19H,1-2H3 |
| InChI Key | NUNVWSSVDPNHPV-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C15H13NO4 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.08445790 g/mol |
| Topological Polar Surface Area (TPSA) | 70.00 Ų |
| XlogP | 2.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 98.29% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.00% | 98.95% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.83% | 85.14% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 94.32% | 93.99% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.13% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.35% | 86.33% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.02% | 94.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.44% | 91.11% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.64% | 89.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 89.46% | 98.75% |
| CHEMBL1899 | P46098 | Serotonin 3a (5-HT3a) receptor | 88.21% | 100.00% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 87.35% | 92.67% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 83.16% | 93.65% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 81.99% | 90.00% |
| CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 81.44% | 80.78% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.12% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Zanthoxylum leprieurii |
| PubChem | 132277135 |
| LOTUS | LTS0121654 |
| wikiData | Q105185960 |