1,2-Dihydrogalanthamine
Internal ID | 77350e6d-f73d-477a-9e63-1e432ba83ba7 |
Taxonomy | Alkaloids and derivatives > Amaryllidaceae alkaloids > Galanthamine-type amaryllidaceae alkaloids |
IUPAC Name | 9-methoxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9-trien-14-ol |
SMILES (Canonical) | CN1CCC23CCC(CC2OC4=C(C=CC(=C34)C1)OC)O |
SMILES (Isomeric) | CN1CCC23CCC(CC2OC4=C(C=CC(=C34)C1)OC)O |
InChI | InChI=1S/C17H23NO3/c1-18-8-7-17-6-5-12(19)9-14(17)21-16-13(20-2)4-3-11(10-18)15(16)17/h3-4,12,14,19H,5-10H2,1-2H3 |
InChI Key | GJRMHIXYLGOZSE-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C17H23NO3 |
Molecular Weight | 289.40 g/mol |
Exact Mass | 289.16779360 g/mol |
Topological Polar Surface Area (TPSA) | 41.90 Ų |
XlogP | 2.00 |
SCHEMBL13991499 |
GJRMHIXYLGOZSE-UHFFFAOYSA-N |
FT-0670886 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL220 | P22303 | Acetylcholinesterase |
610 nM |
IC50 |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.39% | 96.09% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 96.45% | 93.99% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 93.52% | 95.89% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.37% | 95.56% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.11% | 94.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.39% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.31% | 97.09% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 86.79% | 89.62% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.89% | 86.33% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 84.56% | 91.03% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 84.23% | 97.25% |
CHEMBL3023 | Q9NRA0 | Sphingosine kinase 2 | 83.76% | 95.61% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.28% | 92.94% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.83% | 100.00% |
CHEMBL4895 | P30530 | Tyrosine-protein kinase receptor UFO | 80.94% | 90.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Hymenocallis littoralis |
Hymenocallis rotata |
Lycoris incarnata |
Lycoris radiata |
Lycoris sanguinea |
Lycoris squamigera |
Lycoris traubii |
Pancratium maritimum |
PubChem | 625595 |
LOTUS | LTS0231243 |
wikiData | Q105009528 |