1,2-Benzenediol, 3-methoxy-6-(2-(3,4,5-trimethoxyphenyl)ethyl)-
| Internal ID | e577f707-b552-4bf9-a3e3-13e1b12557dd |
| Taxonomy | Phenylpropanoids and polyketides > Stilbenes |
| IUPAC Name | 3-methoxy-6-[2-(3,4,5-trimethoxyphenyl)ethyl]benzene-1,2-diol |
| SMILES (Canonical) | COC1=C(C(=C(C=C1)CCC2=CC(=C(C(=C2)OC)OC)OC)O)O |
| SMILES (Isomeric) | COC1=C(C(=C(C=C1)CCC2=CC(=C(C(=C2)OC)OC)OC)O)O |
| InChI | InChI=1S/C18H22O6/c1-21-13-8-7-12(16(19)17(13)20)6-5-11-9-14(22-2)18(24-4)15(10-11)23-3/h7-10,19-20H,5-6H2,1-4H3 |
| InChI Key | ZSNYQENLWQYSRK-UHFFFAOYSA-N |
| Popularity | 9 references in papers |
| Molecular Formula | C18H22O6 |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.14163842 g/mol |
| Topological Polar Surface Area (TPSA) | 77.40 Ų |
| XlogP | 3.30 |
| Combretastatin B1 |
| 109971-64-4 |
| NK47TS5H6V |
| 3-Methoxy-6-(2-(3,4,5-trimethoxyphenyl)ethyl)-1,2-benzenediol |
| 3-methoxy-6-[2-(3,4,5-trimethoxyphenyl)ethyl]benzene-1,2-diol |
| DTXSID40149083 |
| 3-methoxy-6-(2-(3,4,5-trimethoxyphenyl)ethyl)benzene-1,2-diol |
| RefChem:918949 |
| DTXCID2071574 |
| 1,2-Benzenediol, 3-methoxy-6-(2-(3,4,5-trimethoxyphenyl)ethyl)- |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.21% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.01% | 91.11% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.44% | 86.33% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 91.43% | 90.20% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.74% | 99.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.98% | 98.95% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.98% | 94.00% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 84.81% | 89.62% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.34% | 92.62% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.02% | 94.45% |
| CHEMBL2535 | P11166 | Glucose transporter | 83.53% | 98.75% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 83.31% | 95.17% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 82.17% | 90.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 82.08% | 85.14% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 80.90% | 93.99% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Combretum caffrum |
| Combretum kraussii |
| PubChem | 135716 |
| NPASS | NPC236791 |
| ChEMBL | CHEMBL285152 |
| LOTUS | LTS0108064 |
| wikiData | Q5150957 |