12-Aminododecanoic Acid
| Internal ID | e1f80c33-99ab-4c68-9d71-de58d0393b8f |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty acids and conjugates > Medium-chain fatty acids |
| IUPAC Name | 12-aminododecanoic acid |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C12H25NO2/c13-11-9-7-5-3-1-2-4-6-8-10-12(14)15/h1-11,13H2,(H,14,15) |
| InChI Key | PBLZLIFKVPJDCO-UHFFFAOYSA-N |
| Popularity | 140 references in papers |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.33 g/mol |
| Exact Mass | 215.188529040 g/mol |
| Topological Polar Surface Area (TPSA) | 63.30 Ų |
| XlogP | -0.50 |
| 693-57-2 |
| 12-Aminolauric acid |
| 12-AMINO-DODECANOIC ACID |
| Dodecanoic acid, 12-amino- |
| Omega-Aminododecanoic acid |
| omega-Aminolauric acid |
| 9042RP777G |
| CHEBI:42025 |
| DTXSID90883480 |
| RefChem:437322 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL2903 | P16050 | Arachidonate 15-lipoxygenase |
5 nM |
Potency |
via Super-PRED
|
| CHEMBL1947 | P10828 | Thyroid hormone receptor beta-1 |
398.1 nM |
Potency |
via Super-PRED
|
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.60% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.29% | 99.17% |
| CHEMBL5285 | Q99683 | Mitogen-activated protein kinase kinase kinase 5 | 89.95% | 92.26% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.31% | 91.11% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 84.57% | 96.95% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 83.60% | 93.18% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 82.02% | 90.24% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 81.28% | 97.21% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 80.47% | 90.20% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 69661 |
| LOTUS | LTS0059001 |
| wikiData | Q27271277 |