11Z-Hexadecen-7,9-diynoic acid
| Internal ID | 7041be2f-7ffe-4f49-bc32-9e55ef9375d6 |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty acids and conjugates > Long-chain fatty acids |
| IUPAC Name | (Z)-hexadec-11-en-7,9-diynoic acid |
| SMILES (Canonical) | CCCCC=CC#CC#CCCCCCC(=O)O |
| SMILES (Isomeric) | CCCC/C=C\C#CC#CCCCCCC(=O)O |
| InChI | InChI=1S/C16H22O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h5-6H,2-4,11-15H2,1H3,(H,17,18)/b6-5- |
| InChI Key | ZYKRBUYXWXJLBD-WAYWQWQTSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.34 g/mol |
| Exact Mass | 246.161979940 g/mol |
| Topological Polar Surface Area (TPSA) | 37.30 Ų |
| XlogP | 4.80 |
| Hexadec-11c-en-7,9-diynoic acid |
| Z-11-Hexadecen-7,9-diynoic acid |
| 11-Hexadecen-7,9-diynoic acid, (Z)- |
| (Z)-hexadec-11-en-7,9-diynoic Acid |
| CHEMBL510276 |
| CHEBI:187858 |
| LMFA01031108 |
| cis-hexadeca-11-en-7,9-diynoic acid |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 97.10% | 99.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.56% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.29% | 96.09% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 94.10% | 92.08% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 90.54% | 97.00% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 87.91% | 90.17% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 87.08% | 83.82% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.73% | 96.00% |
| CHEMBL5285 | Q99683 | Mitogen-activated protein kinase kinase kinase 5 | 81.93% | 92.26% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.80% | 93.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Heisteria acuminata |
| PubChem | 10422039 |
| LOTUS | LTS0121127 |
| wikiData | Q76415633 |