[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl] (1R,3aS,5aR,5bR,7aR,9S,11aR,11bR,13aR,13bR)-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-9-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxylate
Internal ID | d87defa4-9028-496d-9ff7-128225469fe0 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Triterpene glycosides > Triterpene saponins |
IUPAC Name | [(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl] (1R,3aS,5aR,5bR,7aR,9S,11aR,11bR,13aR,13bR)-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-9-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxylate |
SMILES (Canonical) | CC(=C)C1CCC2(C1C3CCC4C5(CCC(C(C5CCC4(C3(CC2)C)C)(C)C)OC6C(C(C(C(O6)CO)O)O)O)C)C(=O)OC7C(C(C(C(O7)COC8C(C(C(C(O8)CO)O)O)O)O)O)O |
SMILES (Isomeric) | CC(=C)[C@@H]1CC[C@]2([C@H]1[C@H]3CC[C@@H]4[C@]5(CC[C@@H](C([C@@H]5CC[C@]4([C@@]3(CC2)C)C)(C)C)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O)C)C(=O)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)CO)O)O)O)O)O)O |
InChI | InChI=1S/C48H78O18/c1-21(2)22-10-15-48(43(60)66-42-39(59)36(56)33(53)26(64-42)20-61-40-37(57)34(54)31(51)24(18-49)62-40)17-16-46(6)23(30(22)48)8-9-28-45(5)13-12-29(44(3,4)27(45)11-14-47(28,46)7)65-41-38(58)35(55)32(52)25(19-50)63-41/h22-42,49-59H,1,8-20H2,2-7H3/t22-,23+,24+,25+,26+,27-,28+,29-,30+,31+,32+,33+,34-,35-,36-,37+,38+,39+,40+,41-,42-,45-,46+,47+,48-/m0/s1 |
InChI Key | LOHPNXPOCRDJSL-JZYZLOROSA-N |
Popularity | 2 references in papers |
Molecular Formula | C48H78O18 |
Molecular Weight | 943.10 g/mol |
Exact Mass | 942.51881563 g/mol |
Topological Polar Surface Area (TPSA) | 295.00 Ų |
XlogP | 2.70 |
3beta-(beta-D-Glucopyranosyloxy)lupa-20(29)-ene-28-oic acid 6-O-beta-D-glucopyranosyl-beta-D-glucopyranosyl ester |
![2D Structure of [(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl] (1R,3aS,5aR,5bR,7aR,9S,11aR,11bR,13aR,13bR)-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-9-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxylate 2D Structure of [(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl] (1R,3aS,5aR,5bR,7aR,9S,11aR,11bR,13aR,13bR)-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-9-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxylate](https://plantaedb.com/storage/docs/compounds/2023/07/11e646a0-2447-11ee-b7c5-57f0930fff10.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.34% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.27% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.95% | 97.25% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.88% | 97.09% |
CHEMBL233 | P35372 | Mu opioid receptor | 91.73% | 97.93% |
CHEMBL2581 | P07339 | Cathepsin D | 91.55% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.95% | 94.45% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 89.81% | 96.61% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 89.73% | 91.24% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 88.77% | 92.50% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 87.11% | 92.94% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 86.98% | 82.50% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 86.58% | 95.50% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 86.17% | 97.79% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 85.82% | 92.86% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.20% | 86.33% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.92% | 100.00% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 84.28% | 89.05% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 84.04% | 95.93% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 83.68% | 96.77% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.50% | 99.17% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 83.36% | 96.21% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 83.20% | 93.04% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.14% | 95.89% |
CHEMBL237 | P41145 | Kappa opioid receptor | 82.88% | 98.10% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.82% | 94.33% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 82.56% | 95.83% |
CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 82.12% | 100.00% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.10% | 100.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.03% | 92.62% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.00% | 91.19% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 81.90% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.58% | 95.89% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 80.61% | 96.38% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 80.40% | 97.33% |
CHEMBL5028 | O14672 | ADAM10 | 80.11% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Brunfelsia grandiflora |
Centaurea hermannii |
Oreopanax guatemalensis |
PubChem | 88134720 |
NPASS | NPC116361 |
LOTUS | LTS0199850 |
wikiData | Q105154715 |