11b,13-Dihydrolactucopicrin
Internal ID | 693a58d2-3318-49b4-b604-78757aba74f2 |
Taxonomy | Benzenoids > Phenols > 1-hydroxy-2-unsubstituted benzenoids |
IUPAC Name | [9-(hydroxymethyl)-3,6-dimethyl-2,7-dioxo-3,3a,4,5,9a,9b-hexahydroazuleno[4,5-b]furan-4-yl] 2-(4-hydroxyphenyl)acetate |
SMILES (Canonical) | CC1C2C(CC(=C3C(C2OC1=O)C(=CC3=O)CO)C)OC(=O)CC4=CC=C(C=C4)O |
SMILES (Isomeric) | CC1C2C(CC(=C3C(C2OC1=O)C(=CC3=O)CO)C)OC(=O)CC4=CC=C(C=C4)O |
InChI | InChI=1S/C23H24O7/c1-11-7-17(29-18(27)8-13-3-5-15(25)6-4-13)20-12(2)23(28)30-22(20)21-14(10-24)9-16(26)19(11)21/h3-6,9,12,17,20-22,24-25H,7-8,10H2,1-2H3 |
InChI Key | ICJJPTZLMALYBH-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C23H24O7 |
Molecular Weight | 412.40 g/mol |
Exact Mass | 412.15220310 g/mol |
Topological Polar Surface Area (TPSA) | 110.00 Ų |
XlogP | 1.20 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 95.38% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.94% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.53% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.18% | 85.14% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.34% | 95.89% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.53% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.27% | 86.33% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.22% | 94.00% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.68% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.67% | 97.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.48% | 99.17% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 82.44% | 93.65% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.42% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cichorium endivia |
Cichorium intybus |
Lactuca quercina |
Lactuca saligna |
Lactuca sativa |
Lactuca virosa |
PubChem | 14565841 |
LOTUS | LTS0133217 |
wikiData | Q105111017 |