11alpha-Acetoxy-2alpha-hydroxy-6-deoxydestigloylswietenine acetate
| Internal ID | d9ae2926-0317-4d86-b9d7-e44b5343a747 |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroid lactones |
| IUPAC Name | methyl 2-[(1S,2S,3R,5R,6R,10S,13R,14S,16S)-3,14-diacetyloxy-6-(furan-3-yl)-13-hydroxy-1,5,15,15-tetramethyl-8,17-dioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadec-11-en-16-yl]acetate |
| SMILES (Canonical) | CC(=O)OC1CC2(C(CC(=O)OC2C3=COC=C3)C4=CC5(C(C(C(C(C14)(C5=O)C)CC(=O)OC)(C)C)OC(=O)C)O)C |
| SMILES (Isomeric) | CC(=O)O[C@@H]1C[C@@]2([C@@H](CC(=O)O[C@H]2C3=COC=C3)C4=C[C@]5([C@H](C([C@@H]([C@@]([C@@H]14)(C5=O)C)CC(=O)OC)(C)C)OC(=O)C)O)C |
| InChI | InChI=1S/C31H38O11/c1-15(32)40-20-13-29(5)19(10-23(35)42-25(29)17-8-9-39-14-17)18-12-31(37)26(36)30(6,24(18)20)21(11-22(34)38-7)28(3,4)27(31)41-16(2)33/h8-9,12,14,19-21,24-25,27,37H,10-11,13H2,1-7H3/t19-,20+,21-,24+,25-,27-,29+,30-,31-/m0/s1 |
| InChI Key | JKLCUPWPSAVXMO-VAAZOPOBSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C31H38O11 |
| Molecular Weight | 586.60 g/mol |
| Exact Mass | 586.24141202 g/mol |
| Topological Polar Surface Area (TPSA) | 156.00 Ų |
| XlogP | 1.80 |
| methyl 2-((1S,2S,3R,5R,6R,10S,13R,14S,16S)-3,14-diacetyloxy-6-(furan-3-yl)-13-hydroxy-1,5,15,15-tetramethyl-8,17-dioxo-7-oxatetracyclo(11.3.1.02,11.05,10)heptadec-11-en-16-yl)acetate |
| methyl 2-[(1S,2S,3R,5R,6R,10S,13R,14S,16S)-3,14-diacetyloxy-6-(furan-3-yl)-13-hydroxy-1,5,15,15-tetramethyl-8,17-dioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadec-11-en-16-yl]acetate |
| RefChem:78022 |
| 11alpha-Acetoxy-2alpha-hydroxy-6-deoxydestigloylswietenine acetate |
| CHEMBL2332198 |
| DTXSID601192711 |
| 11I+/--Acetoxy-2I+/--hydroxy-6-deoxydestigloylswietenine acetate |
| (4R,4aR,6R,6aS,7S,8S,10S,11R,12bS)-4-(Furan-3-yl)-11-hydroxy-8-(2-methoxy-2-oxoethyl)-4a,7,9,9-tetramethyl-2,13-dioxo-1,4,4a,5,6,6a,7,8,9,10,11,12b-dodecahydro-2H-7,11-methanocycloocta[3,4]benzo[1,2-c]pyran-6,10-diyl diacetate |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.52% | 94.45% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.38% | 85.14% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.19% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.89% | 96.09% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 89.90% | 91.24% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.68% | 86.33% |
| CHEMBL3038469 | P24941 | CDK2/Cyclin A | 88.25% | 91.38% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 86.96% | 92.88% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 85.77% | 95.71% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.69% | 89.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.93% | 95.89% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 84.43% | 94.33% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 83.79% | 85.30% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.10% | 99.23% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 81.64% | 90.00% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 81.26% | 97.79% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.47% | 100.00% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.41% | 91.07% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.21% | 94.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.02% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Khaya senegalensis |
| PubChem | 44470604 |
| LOTUS | LTS0053501 |
| wikiData | Q105130307 |