(2S,3R,4E,6E)-N-[(E)-1-[[(1S,13E,31S,32S,35R)-10-[(1S)-3-amino-1-hydroxy-3-oxopropyl]-4-(3-amino-3-oxopropyl)-13-ethylidene-21-hydroxy-35-[(1R)-1-hydroxyethyl]-31-methyl-3,6,9,12,15,29,33,36-octaoxo-2,5,8,11,14,24,26,30,34,37-decazatetracyclo[14.12.9.118,22.023,27]octatriaconta-18(38),19,21,23(27),24-pentaen-32-yl]amino]-1-oxobut-2-en-2-yl]-2-hydroxy-3-[(3S,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxypentadeca-4,6-dienamide
| Internal ID | 8be0ec65-529c-49ae-bb18-47306c0ec23e |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Oligopeptides |
| IUPAC Name | (2S,3R,4E,6E)-N-[(E)-1-[[(1S,13E,31S,32S,35R)-10-[(1S)-3-amino-1-hydroxy-3-oxopropyl]-4-(3-amino-3-oxopropyl)-13-ethylidene-21-hydroxy-35-[(1R)-1-hydroxyethyl]-31-methyl-3,6,9,12,15,29,33,36-octaoxo-2,5,8,11,14,24,26,30,34,37-decazatetracyclo[14.12.9.118,22.023,27]octatriaconta-18(38),19,21,23(27),24-pentaen-32-yl]amino]-1-oxobut-2-en-2-yl]-2-hydroxy-3-[(3S,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxypentadeca-4,6-dienamide |
| SMILES (Canonical) | CCCCCCCCC=CC=CC(C(C(=O)NC(=CC)C(=O)NC1C(NC(=O)C2CC3=C(C4=C(C=CC(=C4)CC(C(=O)NC(=CC)C(=O)NC(C(=O)NCC(=O)NC(C(=O)N2)CCC(=O)N)C(CC(=O)N)O)NC(=O)C(NC1=O)C(C)O)O)N=CN3)C)O)OC5C(C(C(CO5)O)O)O |
| SMILES (Isomeric) | CCCCCCCC/C=C/C=C/[C@H]([C@@H](C(=O)N/C(=C/C)/C(=O)N[C@H]1[C@@H](NC(=O)[C@@H]2CC3=C(C4=C(C=CC(=C4)CC(C(=O)N/C(=C/C)/C(=O)NC(C(=O)NCC(=O)NC(C(=O)N2)CCC(=O)N)[C@H](CC(=O)N)O)NC(=O)[C@H](NC1=O)[C@@H](C)O)O)N=CN3)C)O)OC5[C@H]([C@H]([C@@H](CO5)O)O)O |
| InChI | InChI=1S/C63H90N14O21/c1-6-9-10-11-12-13-14-15-16-17-18-43(98-63-53(87)51(85)42(81)28-97-63)52(86)62(96)72-35(8-3)54(88)75-47-30(4)69-57(91)39-25-37-49(68-29-67-37)33-23-32(19-21-40(33)79)24-38(74-61(95)48(31(5)78)76-60(47)94)58(92)71-34(7-2)55(89)77-50(41(80)26-45(65)83)59(93)66-27-46(84)70-36(56(90)73-39)20-22-44(64)82/h7-8,15-19,21,23,29-31,36,38-39,41-43,47-48,50-53,63,78-81,85-87H,6,9-14,20,22,24-28H2,1-5H3,(H2,64,82)(H2,65,83)(H,66,93)(H,67,68)(H,69,91)(H,70,84)(H,71,92)(H,72,96)(H,73,90)(H,74,95)(H,75,88)(H,76,94)(H,77,89)/b16-15+,18-17+,34-7+,35-8+/t30-,31+,36?,38?,39-,41-,42+,43+,47-,48+,50?,51-,52-,53-,63?/m0/s1 |
| InChI Key | LOCMZJSPURXNGX-REQLQVEVSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C63H90N14O21 |
| Molecular Weight | 1379.50 g/mol |
| Exact Mass | 1378.64049593 g/mol |
| Topological Polar Surface Area (TPSA) | 566.00 Ų |
| XlogP | -2.00 |
| Atomic LogP (AlogP) | -5.61 |
| H-Bond Acceptor | 22 |
| H-Bond Donor | 20 |
| Rotatable Bonds | 23 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.7173 | 71.73% |
| Caco-2 | - | 0.8636 | 86.36% |
| Blood Brain Barrier | - | 0.9000 | 90.00% |
| Human oral bioavailability | - | 0.7714 | 77.14% |
| Subcellular localzation | Mitochondria | 0.4596 | 45.96% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.7964 | 79.64% |
| OATP1B3 inhibitior | + | 0.9254 | 92.54% |
| MATE1 inhibitior | - | 0.9400 | 94.00% |
| OCT2 inhibitior | - | 0.9250 | 92.50% |
| BSEP inhibitior | + | 0.9583 | 95.83% |
| P-glycoprotein inhibitior | + | 0.7419 | 74.19% |
| P-glycoprotein substrate | + | 0.8729 | 87.29% |
| CYP3A4 substrate | + | 0.7575 | 75.75% |
| CYP2C9 substrate | - | 1.0000 | 100.00% |
| CYP2D6 substrate | - | 0.8626 | 86.26% |
| CYP3A4 inhibition | - | 0.5116 | 51.16% |
| CYP2C9 inhibition | - | 0.8313 | 83.13% |
| CYP2C19 inhibition | - | 0.8313 | 83.13% |
| CYP2D6 inhibition | - | 0.8761 | 87.61% |
| CYP1A2 inhibition | - | 0.8375 | 83.75% |
| CYP2C8 inhibition | + | 0.8688 | 86.88% |
| CYP inhibitory promiscuity | - | 0.8334 | 83.34% |
| UGT catelyzed | - | 0.5000 | 50.00% |
| Carcinogenicity (binary) | - | 0.8500 | 85.00% |
| Carcinogenicity (trinary) | Non-required | 0.5853 | 58.53% |
| Eye corrosion | - | 0.9853 | 98.53% |
| Eye irritation | - | 0.8957 | 89.57% |
| Skin irritation | - | 0.7651 | 76.51% |
| Skin corrosion | - | 0.9289 | 92.89% |
| Ames mutagenesis | - | 0.5778 | 57.78% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7337 | 73.37% |
| Micronuclear | + | 0.7900 | 79.00% |
| Hepatotoxicity | - | 0.5109 | 51.09% |
| skin sensitisation | - | 0.8594 | 85.94% |
| Respiratory toxicity | + | 0.8556 | 85.56% |
| Reproductive toxicity | + | 0.9778 | 97.78% |
| Mitochondrial toxicity | + | 0.9000 | 90.00% |
| Nephrotoxicity | - | 0.8295 | 82.95% |
| Acute Oral Toxicity (c) | III | 0.6340 | 63.40% |
| Estrogen receptor binding | + | 0.5278 | 52.78% |
| Androgen receptor binding | + | 0.7650 | 76.50% |
| Thyroid receptor binding | + | 0.7893 | 78.93% |
| Glucocorticoid receptor binding | + | 0.8235 | 82.35% |
| Aromatase binding | + | 0.7798 | 77.98% |
| PPAR gamma | + | 0.7310 | 73.10% |
| Honey bee toxicity | - | 0.6243 | 62.43% |
| Biodegradation | - | 0.8250 | 82.50% |
| Crustacea aquatic toxicity | + | 0.6053 | 60.53% |
| Fish aquatic toxicity | + | 0.9262 | 92.62% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.96% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 99.70% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.42% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 98.36% | 99.17% |
| CHEMBL236 | P41143 | Delta opioid receptor | 98.28% | 99.35% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.08% | 85.14% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 97.87% | 92.88% |
| CHEMBL3038469 | P24941 | CDK2/Cyclin A | 97.83% | 91.38% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 96.84% | 90.71% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 96.77% | 91.03% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 96.15% | 83.82% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 95.82% | 96.38% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.19% | 89.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.77% | 94.45% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.36% | 97.09% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 92.86% | 95.89% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 92.29% | 95.93% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 92.06% | 89.34% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 91.72% | 94.75% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 91.49% | 83.10% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 90.80% | 95.71% |
| CHEMBL1075162 | Q13304 | Uracil nucleotide/cysteinyl leukotriene receptor | 90.28% | 80.33% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 90.16% | 96.90% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.65% | 99.23% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 88.62% | 98.59% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 88.05% | 93.03% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 87.95% | 100.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 87.64% | 93.56% |
| CHEMBL2535 | P11166 | Glucose transporter | 87.60% | 98.75% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 87.38% | 91.24% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 86.68% | 100.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 86.52% | 94.73% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 86.09% | 98.03% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 85.74% | 93.10% |
| CHEMBL2850 | P49840 | Glycogen synthase kinase-3 alpha | 85.53% | 88.84% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 85.43% | 90.24% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 85.32% | 82.38% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 84.91% | 99.15% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 84.52% | 85.00% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 84.41% | 100.00% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 83.99% | 97.53% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 83.97% | 89.50% |
| CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 83.97% | 83.00% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 83.38% | 91.07% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.63% | 96.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.52% | 86.33% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 82.34% | 96.47% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 82.26% | 90.08% |
| CHEMBL2208 | P49137 | MAP kinase-activated protein kinase 2 | 82.11% | 95.20% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 81.98% | 97.33% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 81.91% | 95.83% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 81.51% | 89.62% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 80.68% | 95.50% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 80.67% | 94.80% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 80.64% | 97.64% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 6475021 |
| LOTUS | LTS0147710 |
| wikiData | Q105154638 |