1,1,5-Trimethylfuro[3,4-c]pyridine-3,4-dione
| Internal ID | 72556bc0-c571-44e4-8cad-d165e2bfdc35 |
| Taxonomy | Organoheterocyclic compounds > Pyridines and derivatives > Pyridinecarboxylic acids and derivatives > Pyridinecarboxylic acids |
| IUPAC Name | 1,1,5-trimethylfuro[3,4-c]pyridine-3,4-dione |
| SMILES (Canonical) | CC1(C2=C(C(=O)N(C=C2)C)C(=O)O1)C |
| SMILES (Isomeric) | CC1(C2=C(C(=O)N(C=C2)C)C(=O)O1)C |
| InChI | InChI=1S/C10H11NO3/c1-10(2)6-4-5-11(3)8(12)7(6)9(13)14-10/h4-5H,1-3H3 |
| InChI Key | ANFMKCSQXDEJMT-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07389321 g/mol |
| Topological Polar Surface Area (TPSA) | 46.60 Ų |
| XlogP | 0.20 |
| NSC664901 |
| 1,1,5-trimethylfuro[3,4-c]pyridine-3,4-dione |
| 1,1,5-Trimethylfuro[3,4-c]pyridine-3,4(1H,5H)-dione |
| CHEMBL1971143 |
| DTXSID50327537 |
| NSC-664901 |
| NCI60_022352 |
| 3,1,5-trimethyl-1,3,4,5-tetrahydrofuro-[3,4-c]-pyridine |
| 3,4-Dioxo-1,1,5-trimethyl-1,3,4,5-tetrahydrofuro-[3,4-c]-pyridine |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.69% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.16% | 98.95% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 91.28% | 90.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.07% | 86.33% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.96% | 96.09% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.27% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Ceropegia juncea |
| PubChem | 379803 |
| LOTUS | LTS0180017 |
| wikiData | Q82089406 |