1,1,4,7-Tetramethyl-1a,2,3,5,6,7,7a,7b-octahydrocyclopropa[e]azulene
| Internal ID | 44a1e6b7-3b17-4ee1-b9bf-faa8f402efce |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids > Aromadendrane sesquiterpenoids > 5,10-cycloaromadendrane sesquiterpenoids |
| IUPAC Name | 1,1,4,7-tetramethyl-1a,2,3,5,6,7,7a,7b-octahydrocyclopropa[e]azulene |
| SMILES (Canonical) | CC1CCC2=C(CCC3C(C12)C3(C)C)C |
| SMILES (Isomeric) | CC1CCC2=C(CCC3C(C12)C3(C)C)C |
| InChI | InChI=1S/C15H24/c1-9-6-8-12-14(15(12,3)4)13-10(2)5-7-11(9)13/h10,12-14H,5-8H2,1-4H3 |
| InChI Key | WGTRJVCFDUCKCM-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.35 g/mol |
| Exact Mass | 204.187800766 g/mol |
| Topological Polar Surface Area (TPSA) | 0.00 Ų |
| XlogP | 4.00 |
| 1,1,4,7-Tetramethyl-1a,2,3,5,6,7,7a,7b-octahydro-1H-cyclopropa[e]azulene-, [1aR-(1a.alpha.,7.alpha.,7a.beta.,7b.alpha.)]- |
| 1H-Cycloprop[e]azulene, 1a,2,3,5,6,7,7a,7b-octahydro-1,1,4,7-tetramethyl-, [1aR-(1a.alpha.,7.alpha.,7a.beta.,7b.alpha.)]- |
| 1,1,4,7-tetramethyl-1a,2,3,5,6,7,7a,7b-octahydrocyclopropa[e]azulene |
| FT-0638146 |
![2D Structure of 1,1,4,7-Tetramethyl-1a,2,3,5,6,7,7a,7b-octahydrocyclopropa[e]azulene](https://plantaedb.com/storage/docs/compounds/2023/11/1147-tetramethyl-1a235677a7b-octahydrocyclopropaeazulene.jpg "2D Structure of 1,1,4,7-Tetramethyl-1a,2,3,5,6,7,7a,7b-octahydrocyclopropa[e]azulene")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.71% | 96.09% |
| CHEMBL1871 | P10275 | Androgen Receptor | 88.92% | 96.43% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.82% | 91.11% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 87.72% | 90.17% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 87.05% | 92.94% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.51% | 100.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.47% | 97.09% |
| CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 84.70% | 86.00% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 82.60% | 97.79% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.67% | 95.56% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.56% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Cassinia laevis |
| Chrysanthemum indicum |
| Jackiella javanica |
| Melaleuca alternifolia |
| Melaleuca leucadendra |
| Pinus heldreichii |
| Plagiochila parvifolia |
| Rhododendron groenlandicum |
| Valeriana officinalis |
| PubChem | 89532 |
| LOTUS | LTS0234422 |
| wikiData | Q105304945 |