[6-[2-(3,4-Dihydroxyphenyl)-5,7-dihydroxy-4-oxochromen-3-yl]oxy-4,5-dihydroxy-2-(hydroxymethyl)oxan-3-yl] 3,4,5-trihydroxybenzoate
| Internal ID | d7ac6fd4-7657-4ad4-bef2-e80b646d1d2b |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-3-O-glycosides |
| IUPAC Name | [6-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxochromen-3-yl]oxy-4,5-dihydroxy-2-(hydroxymethyl)oxan-3-yl] 3,4,5-trihydroxybenzoate |
| SMILES (Canonical) | C1=CC(=C(C=C1C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)OC4C(C(C(C(O4)CO)OC(=O)C5=CC(=C(C(=C5)O)O)O)O)O)O)O |
| SMILES (Isomeric) | C1=CC(=C(C=C1C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)OC4C(C(C(C(O4)CO)OC(=O)C5=CC(=C(C(=C5)O)O)O)O)O)O)O |
| InChI | InChI=1S/C28H24O16/c29-8-18-25(43-27(40)10-4-15(34)20(36)16(35)5-10)22(38)23(39)28(42-18)44-26-21(37)19-14(33)6-11(30)7-17(19)41-24(26)9-1-2-12(31)13(32)3-9/h1-7,18,22-23,25,28-36,38-39H,8H2 |
| InChI Key | XBZZMHIOMCJGLC-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C28H24O16 |
| Molecular Weight | 616.50 g/mol |
| Exact Mass | 616.10643467 g/mol |
| Topological Polar Surface Area (TPSA) | 273.00 Ų |
| XlogP | 1.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.72% | 91.11% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.69% | 89.00% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 97.66% | 91.49% |
| CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 97.40% | 95.64% |
| CHEMBL3194 | P02766 | Transthyretin | 96.40% | 90.71% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.23% | 98.95% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.66% | 94.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.62% | 99.17% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.17% | 86.33% |
| CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 91.77% | 83.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.89% | 99.15% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 89.82% | 95.78% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 88.81% | 94.73% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 84.68% | 94.42% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 84.34% | 86.92% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.21% | 97.09% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.00% | 96.09% |
| CHEMBL245 | P20309 | Muscarinic acetylcholine receptor M3 | 82.64% | 97.53% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 82.51% | 90.00% |
| CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 81.64% | 80.78% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.14% | 99.23% |
| CHEMBL4530 | P00488 | Coagulation factor XIII | 80.88% | 96.00% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.47% | 94.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Tellima grandiflora |
| PubChem | 162844174 |
| LOTUS | LTS0231378 |
| wikiData | Q105324850 |