[7-(Furan-3-yl)-20-hydroxy-1,8,12,17,17-pentamethyl-5,15-dioxo-3,6,16-trioxapentacyclo[9.9.0.02,4.02,8.012,18]icos-13-en-10-yl] acetate
Internal ID | 8cf89e1a-702e-48f9-8741-52d59b806070 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids > Limonoids |
IUPAC Name | [7-(furan-3-yl)-20-hydroxy-1,8,12,17,17-pentamethyl-5,15-dioxo-3,6,16-trioxapentacyclo[9.9.0.02,4.02,8.012,18]icos-13-en-10-yl] acetate |
SMILES (Canonical) | CC(=O)OC1CC2(C(OC(=O)C3C2(O3)C4(C1C5(C=CC(=O)OC(C5CC4O)(C)C)C)C)C6=COC=C6)C |
SMILES (Isomeric) | CC(=O)OC1CC2(C(OC(=O)C3C2(O3)C4(C1C5(C=CC(=O)OC(C5CC4O)(C)C)C)C)C6=COC=C6)C |
InChI | InChI=1S/C28H34O9/c1-14(29)34-16-12-26(5)21(15-8-10-33-13-15)35-23(32)22-28(26,37-22)27(6)18(30)11-17-24(2,3)36-19(31)7-9-25(17,4)20(16)27/h7-10,13,16-18,20-22,30H,11-12H2,1-6H3 |
InChI Key | XZMXAKZLHDEKJD-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C28H34O9 |
Molecular Weight | 514.60 g/mol |
Exact Mass | 514.22028266 g/mol |
Topological Polar Surface Area (TPSA) | 125.00 Ų |
XlogP | 2.90 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.79% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.67% | 94.45% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.20% | 85.14% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.83% | 97.09% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.49% | 99.23% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.42% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.35% | 96.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.24% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.26% | 94.00% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 84.96% | 94.75% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.70% | 100.00% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 84.65% | 94.08% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.02% | 91.19% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 83.97% | 100.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.92% | 95.56% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 80.78% | 89.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cedrela odorata |
PubChem | 74343956 |
LOTUS | LTS0073005 |
wikiData | Q105345047 |