1,10-Dihydroxy-2-methoxyaporphine
| Internal ID | 2880aa01-df65-4be4-ac66-8a2b3d069c82 |
| Taxonomy | Alkaloids and derivatives > Aporphines |
| IUPAC Name | 2-methoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-1,10-diol |
| SMILES (Canonical) | CN1CCC2=CC(=C(C3=C2C1CC4=C3C=C(C=C4)O)O)OC |
| SMILES (Isomeric) | CN1CCC2=CC(=C(C3=C2C1CC4=C3C=C(C=C4)O)O)OC |
| InChI | InChI=1S/C18H19NO3/c1-19-6-5-11-8-15(22-2)18(21)17-13-9-12(20)4-3-10(13)7-14(19)16(11)17/h3-4,8-9,14,20-21H,5-7H2,1-2H3 |
| InChI Key | QZGHIQMJUDEEIB-UHFFFAOYSA-N |
| Popularity | 4 references in papers |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 297.13649347 g/mol |
| Topological Polar Surface Area (TPSA) | 52.90 Ų |
| XlogP | 2.30 |
| AC1L9CDE |
| SCHEMBL11253334 |
| 1,10-dihydroxy-2-methoxyaporphine |
| NSC785186 |
| NSC-785186 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.25% | 96.09% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 97.32% | 95.62% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 96.41% | 91.79% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 95.36% | 91.49% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 94.39% | 91.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.01% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.70% | 91.11% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 92.44% | 90.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.96% | 95.56% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 91.38% | 89.62% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 91.20% | 95.89% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.94% | 86.33% |
| CHEMBL3438 | Q05513 | Protein kinase C zeta | 89.52% | 88.48% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 89.48% | 95.89% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 86.13% | 93.40% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 85.94% | 91.03% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 85.84% | 82.38% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 85.48% | 92.94% |
| CHEMBL2535 | P11166 | Glucose transporter | 84.94% | 98.75% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 84.51% | 85.14% |
| CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 83.67% | 95.34% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.06% | 99.17% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.97% | 94.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.48% | 90.71% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 82.10% | 95.78% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Annona purpurea |
| Croton bonplandianus |
| PubChem | 422679 |
| LOTUS | LTS0075627 |
| wikiData | Q105232031 |