11-Oxomogroside III
Internal ID | b54be907-0bc0-4464-b485-e47f82882daa |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins > Cucurbitacin glycosides |
IUPAC Name | (3S,8S,9R,10R,13R,14S,17R)-17-[(2R,5R)-6-hydroxy-6-methyl-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxyheptan-2-yl]-4,4,9,13,14-pentamethyl-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,2,3,7,8,10,12,15,16,17-decahydrocyclopenta[a]phenanthren-11-one |
SMILES (Canonical) | CC(CCC(C(C)(C)O)OC1C(C(C(C(O1)COC2C(C(C(C(O2)CO)O)O)O)O)O)O)C3CCC4(C3(CC(=O)C5(C4CC=C6C5CCC(C6(C)C)OC7C(C(C(C(O7)CO)O)O)O)C)C)C |
SMILES (Isomeric) | C[C@H](CC[C@H](C(C)(C)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)O)O)O)[C@H]3CC[C@@]4([C@@]3(CC(=O)[C@@]5([C@H]4CC=C6[C@H]5CC[C@@H](C6(C)C)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O)O)O)C)C)C |
InChI | InChI=1S/C48H80O19/c1-21(9-13-31(45(4,5)61)67-43-40(60)37(57)34(54)27(65-43)20-62-41-38(58)35(55)32(52)25(18-49)63-41)22-15-16-46(6)28-12-10-23-24(48(28,8)29(51)17-47(22,46)7)11-14-30(44(23,2)3)66-42-39(59)36(56)33(53)26(19-50)64-42/h10,21-22,24-28,30-43,49-50,52-61H,9,11-20H2,1-8H3/t21-,22-,24-,25-,26-,27-,28+,30+,31-,32-,33-,34-,35+,36+,37+,38-,39-,40-,41-,42+,43+,46+,47-,48+/m1/s1 |
InChI Key | DTTRSWYYQQKYKT-KEMCFQJVSA-N |
Popularity | 4 references in papers |
Molecular Formula | C48H80O19 |
Molecular Weight | 961.10 g/mol |
Exact Mass | 960.52938032 g/mol |
Topological Polar Surface Area (TPSA) | 315.00 Ų |
XlogP | -0.30 |
11-?Oxomogroside III |
952481-53-7 |
HY-N6921 |
AKOS040760181 |
PD125012 |
CS-0100732 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.01% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.95% | 97.25% |
CHEMBL2581 | P07339 | Cathepsin D | 97.03% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.49% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.37% | 97.09% |
CHEMBL220 | P22303 | Acetylcholinesterase | 92.71% | 94.45% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 92.07% | 93.04% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 91.92% | 96.61% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 91.58% | 97.79% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.06% | 95.56% |
CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 88.73% | 100.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.82% | 86.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.37% | 94.45% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 86.46% | 93.56% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.60% | 94.00% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 85.52% | 94.75% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 85.16% | 96.21% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.86% | 92.62% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.61% | 99.23% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.44% | 94.73% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.14% | 100.00% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 82.60% | 93.18% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.59% | 97.14% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.19% | 95.89% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 82.06% | 92.50% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 81.97% | 91.07% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.02% | 89.00% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.85% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Siraitia grosvenorii |
PubChem | 17752183 |
LOTUS | LTS0024861 |
wikiData | Q104989031 |