11-Methoxyakuammicine
Internal ID | ba725eeb-f09f-4e3b-bc3e-1356bd396f09 |
Taxonomy | Alkaloids and derivatives > Strychnos alkaloids |
IUPAC Name | methyl (1R,11S,12E,17S)-12-ethylidene-5-methoxy-8,14-diazapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2(7),3,5,9-tetraene-10-carboxylate |
SMILES (Canonical) | CC=C1CN2CCC34C2CC1C(=C3NC5=C4C=CC(=C5)OC)C(=O)OC |
SMILES (Isomeric) | C/C=C\1/CN2CC[C@@]34[C@@H]2C[C@@H]1C(=C3NC5=C4C=CC(=C5)OC)C(=O)OC |
InChI | InChI=1S/C21H24N2O3/c1-4-12-11-23-8-7-21-15-6-5-13(25-2)9-16(15)22-19(21)18(20(24)26-3)14(12)10-17(21)23/h4-6,9,14,17,22H,7-8,10-11H2,1-3H3/b12-4-/t14-,17-,21+/m0/s1 |
InChI Key | AWDINAQEZMNGBT-ZSLDGBIMSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H24N2O3 |
Molecular Weight | 352.40 g/mol |
Exact Mass | 352.17869263 g/mol |
Topological Polar Surface Area (TPSA) | 50.80 Ų |
XlogP | 2.30 |
There are no found synonyms. |
![2D Structure of 11-Methoxyakuammicine 2D Structure of 11-Methoxyakuammicine](https://plantaedb.com/storage/docs/compounds/2023/11/11-methoxyakuammicine.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.75% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.54% | 91.11% |
CHEMBL4208 | P20618 | Proteasome component C5 | 96.01% | 90.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.44% | 94.45% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.10% | 85.14% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 91.39% | 91.03% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.46% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.54% | 95.56% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.42% | 95.89% |
CHEMBL2535 | P11166 | Glucose transporter | 86.14% | 98.75% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 85.80% | 91.07% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.04% | 86.33% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.53% | 90.71% |
CHEMBL284 | P27487 | Dipeptidyl peptidase IV | 81.85% | 95.69% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.30% | 97.14% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.07% | 91.19% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Alstonia angustifolia |
Alstonia balansae |
Alstonia lenormandii |
Alstonia macrophylla |
Alstonia muelleriana |
PubChem | 163184390 |
LOTUS | LTS0213894 |
wikiData | Q104919975 |