11-Methoxy-5,6-dihydronaphtho[2,1-f][1,3]benzodioxol-3-ol
| Internal ID | 5fa781b5-75cf-43a3-b0f6-ed5a61d87921 |
| Taxonomy | Benzenoids > Phenanthrenes and derivatives |
| IUPAC Name | 11-methoxy-5,6-dihydronaphtho[2,1-f][1,3]benzodioxol-3-ol |
| SMILES (Canonical) | COC1=C2C(=CC3=C1OCO3)CCC4=C2C=CC(=C4)O |
| SMILES (Isomeric) | COC1=C2C(=CC3=C1OCO3)CCC4=C2C=CC(=C4)O |
| InChI | InChI=1S/C16H14O4/c1-18-16-14-10(7-13-15(16)20-8-19-13)3-2-9-6-11(17)4-5-12(9)14/h4-7,17H,2-3,8H2,1H3 |
| InChI Key | UBPAHAKOHHAPHZ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C16H14O4 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.08920892 g/mol |
| Topological Polar Surface Area (TPSA) | 47.90 Ų |
| XlogP | 3.30 |
| There are no found synonyms. |
![2D Structure of 11-Methoxy-5,6-dihydronaphtho[2,1-f][1,3]benzodioxol-3-ol](https://plantaedb.com/storage/docs/compounds/2023/11/11-methoxy-56-dihydronaphtho21-f13benzodioxol-3-ol.jpg "2D Structure of 11-Methoxy-5,6-dihydronaphtho[2,1-f][1,3]benzodioxol-3-ol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.06% | 91.11% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 96.92% | 98.35% |
| CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 95.05% | 82.67% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.20% | 86.33% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.10% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.27% | 98.95% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 90.36% | 96.77% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 90.16% | 91.49% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.94% | 94.45% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.61% | 95.56% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 87.01% | 90.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.75% | 99.17% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.27% | 94.00% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 83.42% | 95.78% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 83.29% | 91.00% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.16% | 92.62% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.87% | 95.89% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.20% | 94.73% |
| CHEMBL2535 | P11166 | Glucose transporter | 80.49% | 98.75% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 80.45% | 93.10% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 80.35% | 91.79% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Bulbophyllum andersonii |
| PubChem | 101615677 |
| LOTUS | LTS0036963 |
| wikiData | Q104396996 |