(11-Methoxy-3,3-dimethyl-7,12-dimethylidene-10-oxatricyclo[6.4.0.02,4]dodecan-9-yl) acetate
| Internal ID | 986e514e-7f20-4c28-9c1c-73b5f8b755bc |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids > Aromadendrane sesquiterpenoids |
| IUPAC Name | (11-methoxy-3,3-dimethyl-7,12-dimethylidene-10-oxatricyclo[6.4.0.02,4]dodecan-9-yl) acetate |
| SMILES (Canonical) | CC(=O)OC1C2C(C3C(C3(C)C)CCC2=C)C(=C)C(O1)OC |
| SMILES (Isomeric) | CC(=O)OC1C2C(C3C(C3(C)C)CCC2=C)C(=C)C(O1)OC |
| InChI | InChI=1S/C18H26O4/c1-9-7-8-12-15(18(12,4)5)14-10(2)16(20-6)22-17(13(9)14)21-11(3)19/h12-17H,1-2,7-8H2,3-6H3 |
| InChI Key | XZWTYQVMLSCUGD-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18310931 g/mol |
| Topological Polar Surface Area (TPSA) | 44.80 Ų |
| XlogP | 2.80 |
| There are no found synonyms. |
![2D Structure of (11-Methoxy-3,3-dimethyl-7,12-dimethylidene-10-oxatricyclo[6.4.0.02,4]dodecan-9-yl) acetate](https://plantaedb.com/storage/docs/compounds/2023/11/11-methoxy-33-dimethyl-712-dimethylidene-10-oxatricyclo640024dodecan-9-yl-acetate.jpg "2D Structure of (11-Methoxy-3,3-dimethyl-7,12-dimethylidene-10-oxatricyclo[6.4.0.02,4]dodecan-9-yl) acetate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.13% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.45% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.51% | 94.45% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.89% | 91.19% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 87.68% | 92.94% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.16% | 100.00% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 85.13% | 97.28% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.45% | 95.89% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.03% | 97.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 82.74% | 85.14% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.02% | 94.33% |
| CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 80.89% | 89.05% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.14% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Plagiochila parvifolia |
| Plagiochila semidecurrens |
| PubChem | 163083952 |
| LOTUS | LTS0220989 |
| wikiData | Q105345218 |