11-Methoxy-3,3-dimethyl-3h-furo[2,3-b]pyrano[3,2-f]quinoline
| Internal ID | de8fe1d4-9f64-425b-bb04-c532538f45c2 |
| Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Chromenopyridines |
| IUPAC Name | 17-methoxy-5,5-dimethyl-6,13-dioxa-11-azatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2(7),3,8,11,14,16-heptaene |
| SMILES (Canonical) | CC1(C=CC2=C(O1)C=CC3=C2C(=C4C=COC4=N3)OC)C |
| SMILES (Isomeric) | CC1(C=CC2=C(O1)C=CC3=C2C(=C4C=COC4=N3)OC)C |
| InChI | InChI=1S/C17H15NO3/c1-17(2)8-6-10-13(21-17)5-4-12-14(10)15(19-3)11-7-9-20-16(11)18-12/h4-9H,1-3H3 |
| InChI Key | WVBLHNOAFTUBSS-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C17H15NO3 |
| Molecular Weight | 281.30 g/mol |
| Exact Mass | 281.10519334 g/mol |
| Topological Polar Surface Area (TPSA) | 44.50 Ų |
| XlogP | 3.80 |
| NSC103009 |
| 11-methoxy-3,3-dimethyl-3h-furo[2,3-b]pyrano[3,2-f]quinoline |
| NCIOpen2_007095 |
| DTXSID00295550 |
| NSC-103009 |
![2D Structure of 11-Methoxy-3,3-dimethyl-3h-furo[2,3-b]pyrano[3,2-f]quinoline](https://plantaedb.com/storage/docs/compounds/2023/11/11-methoxy-33-dimethyl-3h-furo23-bpyrano32-fquinoline.jpg "2D Structure of 11-Methoxy-3,3-dimethyl-3h-furo[2,3-b]pyrano[3,2-f]quinoline")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.49% | 94.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.86% | 91.11% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 93.14% | 85.30% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.16% | 94.00% |
| CHEMBL4225 | P49760 | Dual specificity protein kinase CLK2 | 89.35% | 80.96% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.17% | 85.14% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.98% | 96.09% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.03% | 96.00% |
| CHEMBL235 | P37231 | Peroxisome proliferator-activated receptor gamma | 86.00% | 95.39% |
| CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 85.74% | 89.44% |
| CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 85.53% | 94.03% |
| CHEMBL5747 | Q92793 | CREB-binding protein | 83.85% | 95.12% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.68% | 86.33% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 83.40% | 96.67% |
| CHEMBL290 | Q13370 | Phosphodiesterase 3B | 83.06% | 94.00% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 83.01% | 100.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.89% | 99.23% |
| CHEMBL2581 | P07339 | Cathepsin D | 82.28% | 98.95% |
| CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 81.11% | 85.49% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 80.50% | 94.73% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.44% | 95.56% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.33% | 94.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 266041 |
| LOTUS | LTS0073539 |
| wikiData | Q82035526 |