11-methoxy-2-methyl-3,4-dihydro-1H-naphtho[2,1-f]isoquinolin-12-ol
| Internal ID | 877be788-559a-4287-8ea8-b80b73b4e212 |
| Taxonomy | Benzenoids > Phenanthrenes and derivatives > Phenanthrols |
| IUPAC Name | 11-methoxy-2-methyl-3,4-dihydro-1H-naphtho[2,1-f]isoquinolin-12-ol |
| SMILES (Canonical) | CN1CCC2=C3C=CC4=CC=CC=C4C3=C(C(=C2C1)O)OC |
| SMILES (Isomeric) | CN1CCC2=C3C=CC4=CC=CC=C4C3=C(C(=C2C1)O)OC |
| InChI | InChI=1S/C19H19NO2/c1-20-10-9-14-15-8-7-12-5-3-4-6-13(12)17(15)19(22-2)18(21)16(14)11-20/h3-8,21H,9-11H2,1-2H3 |
| InChI Key | CBZPNEPYJIGFQZ-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C19H19NO2 |
| Molecular Weight | 293.40 g/mol |
| Exact Mass | 293.141578849 g/mol |
| Topological Polar Surface Area (TPSA) | 32.70 Ų |
| XlogP | 3.90 |
| There are no found synonyms. |
![2D Structure of 11-methoxy-2-methyl-3,4-dihydro-1H-naphtho[2,1-f]isoquinolin-12-ol](https://plantaedb.com/storage/docs/compounds/2023/11/11-methoxy-2-methyl-34-dihydro-1h-naphtho21-fisoquinolin-12-ol.jpg "2D Structure of 11-methoxy-2-methyl-3,4-dihydro-1H-naphtho[2,1-f]isoquinolin-12-ol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.71% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.54% | 96.09% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 94.94% | 93.99% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 93.97% | 91.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.32% | 95.56% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.12% | 94.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 88.87% | 98.75% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.92% | 98.95% |
| CHEMBL240 | Q12809 | HERG | 87.91% | 89.76% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 87.66% | 91.49% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 86.32% | 90.00% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 85.50% | 93.65% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 83.57% | 95.83% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 82.07% | 96.67% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.95% | 99.23% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.89% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Annona montana |
| PubChem | 10447107 |
| LOTUS | LTS0149737 |
| wikiData | Q104953007 |