11-hydroxy-N-(2-methylpropyl)tetradeca-2,4,8-trienamide
Internal ID | 3abc9033-fde8-45d6-b2f3-277df1889f5e |
Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty amides > N-acyl amines |
IUPAC Name | 11-hydroxy-N-(2-methylpropyl)tetradeca-2,4,8-trienamide |
SMILES (Canonical) | CCCC(CC=CCCC=CC=CC(=O)NCC(C)C)O |
SMILES (Isomeric) | CCCC(CC=CCCC=CC=CC(=O)NCC(C)C)O |
InChI | InChI=1S/C18H31NO2/c1-4-12-17(20)13-10-8-6-5-7-9-11-14-18(21)19-15-16(2)3/h7-11,14,16-17,20H,4-6,12-13,15H2,1-3H3,(H,19,21) |
InChI Key | AGSDDWKTIRYHSX-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C18H31NO2 |
Molecular Weight | 293.40 g/mol |
Exact Mass | 293.235479232 g/mol |
Topological Polar Surface Area (TPSA) | 49.30 Ų |
XlogP | 4.10 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 96.77% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.88% | 96.09% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 94.76% | 97.29% |
CHEMBL203 | P00533 | Epidermal growth factor receptor erbB1 | 92.99% | 97.34% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 92.48% | 89.34% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.51% | 99.17% |
CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 88.49% | 100.00% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 88.37% | 96.38% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 88.16% | 93.56% |
CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 86.98% | 95.71% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.25% | 94.73% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 83.88% | 96.47% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.70% | 100.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.30% | 94.45% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.42% | 96.00% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 81.09% | 98.75% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.58% | 94.33% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.53% | 90.71% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 80.36% | 83.82% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Zanthoxylum integrifoliolum |
PubChem | 163037919 |
LOTUS | LTS0214514 |
wikiData | Q104667915 |