11-Hydroxy-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-6-one
| Internal ID | f1741741-f393-4f48-8c9e-6836b9218bc9 |
| Taxonomy | Alkaloids and derivatives > Lupin alkaloids > Matrine alkaloids |
| IUPAC Name | 11-hydroxy-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-6-one |
| SMILES (Canonical) | C1CC2C3CCCN4C3C(CC(C4)O)CN2C(=O)C1 |
| SMILES (Isomeric) | C1CC2C3CCCN4C3C(CC(C4)O)CN2C(=O)C1 |
| InChI | InChI=1S/C15H24N2O2/c18-11-7-10-8-17-13(4-1-5-14(17)19)12-3-2-6-16(9-11)15(10)12/h10-13,15,18H,1-9H2 |
| InChI Key | JNLSSIFKBWSCKD-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.183778013 g/mol |
| Topological Polar Surface Area (TPSA) | 43.80 Ų |
| XlogP | 0.60 |
| There are no found synonyms. |
![2D Structure of 11-Hydroxy-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-6-one](https://plantaedb.com/storage/docs/compounds/2023/11/11-hydroxy-713-diazatetracyclo77102701317heptadecan-6-one.jpg "2D Structure of 11-Hydroxy-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-6-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.57% | 97.09% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 89.70% | 95.58% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.47% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.92% | 95.56% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 88.85% | 93.03% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 86.83% | 96.03% |
| CHEMBL2581 | P07339 | Cathepsin D | 86.59% | 98.95% |
| CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 85.71% | 94.78% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 85.45% | 93.04% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 85.03% | 95.62% |
| CHEMBL4235 | P28845 | 11-beta-hydroxysteroid dehydrogenase 1 | 84.48% | 97.98% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.44% | 96.09% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.25% | 95.89% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 83.10% | 97.25% |
| CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 82.80% | 98.46% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.28% | 100.00% |
| CHEMBL238 | Q01959 | Dopamine transporter | 81.40% | 95.88% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.32% | 92.50% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.05% | 92.94% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.69% | 99.23% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 80.55% | 98.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Sophora alopecuroides |
| PubChem | 163010490 |
| LOTUS | LTS0164461 |
| wikiData | Q105131997 |