11-But-3-enyl-7,11-diazatricyclo[7.3.1.02,7]tridecane-8,10-dione
| Internal ID | 7e0aba33-4586-47bb-adbc-f1ee80fdc203 |
| Taxonomy | Organoheterocyclic compounds > Quinolizidines > Quinolizidinones |
| IUPAC Name | 11-but-3-enyl-7,11-diazatricyclo[7.3.1.02,7]tridecane-8,10-dione |
| SMILES (Canonical) | C=CCCN1CC2CC(C1=O)C(=O)N3C2CCCC3 |
| SMILES (Isomeric) | C=CCCN1CC2CC(C1=O)C(=O)N3C2CCCC3 |
| InChI | InChI=1S/C15H22N2O2/c1-2-3-7-16-10-11-9-12(14(16)18)15(19)17-8-5-4-6-13(11)17/h2,11-13H,1,3-10H2 |
| InChI Key | IFSYEEHQUSCGTN-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.168127949 g/mol |
| Topological Polar Surface Area (TPSA) | 40.60 Ų |
| XlogP | 1.60 |
| There are no found synonyms. |
![2D Structure of 11-But-3-enyl-7,11-diazatricyclo[7.3.1.02,7]tridecane-8,10-dione](https://plantaedb.com/storage/docs/compounds/2023/11/11-but-3-enyl-711-diazatricyclo731027tridecane-810-dione.jpg "2D Structure of 11-But-3-enyl-7,11-diazatricyclo[7.3.1.02,7]tridecane-8,10-dione")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.76% | 97.25% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 95.03% | 97.05% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.45% | 98.95% |
| CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 93.36% | 83.57% |
| CHEMBL228 | P31645 | Serotonin transporter | 92.66% | 95.51% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 91.41% | 93.00% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 91.27% | 95.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.98% | 96.09% |
| CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 90.86% | 94.78% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.41% | 95.56% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.35% | 97.09% |
| CHEMBL1978 | P11511 | Cytochrome P450 19A1 | 87.81% | 91.76% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 87.66% | 93.40% |
| CHEMBL4235 | P28845 | 11-beta-hydroxysteroid dehydrogenase 1 | 87.57% | 97.98% |
| CHEMBL238 | Q01959 | Dopamine transporter | 87.22% | 95.88% |
| CHEMBL2730 | P21980 | Protein-glutamine gamma-glutamyltransferase | 86.74% | 92.38% |
| CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 86.00% | 86.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.30% | 95.89% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 84.77% | 90.08% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 84.47% | 95.50% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 83.53% | 98.33% |
| CHEMBL264 | Q9Y5N1 | Histamine H3 receptor | 82.66% | 91.43% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 81.94% | 93.03% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 81.91% | 95.93% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 81.82% | 90.24% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 81.56% | 82.69% |
| CHEMBL1871 | P10275 | Androgen Receptor | 80.69% | 96.43% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 80.55% | 97.64% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Ormosia coutinhoi |
| PubChem | 162848981 |
| LOTUS | LTS0257477 |
| wikiData | Q105112370 |