11-(5-carbamoyl-4-oxo-1H-pyridin-2-yl)undec-10-enoic acid
| Internal ID | 516190b1-1ff8-4a9b-aee7-0576d1ee44f1 |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty acids and conjugates > Long-chain fatty acids |
| IUPAC Name | 11-(5-carbamoyl-4-oxo-1H-pyridin-2-yl)undec-10-enoic acid |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C17H24N2O4/c18-17(23)14-12-19-13(11-15(14)20)9-7-5-3-1-2-4-6-8-10-16(21)22/h7,9,11-12H,1-6,8,10H2,(H2,18,23)(H,19,20)(H,21,22) |
| InChI Key | FQHXRDDMWDQLPV-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.17360725 g/mol |
| Topological Polar Surface Area (TPSA) | 109.00 Ų |
| XlogP | 3.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.76% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.83% | 94.45% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.70% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.43% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.54% | 99.17% |
| CHEMBL5285 | Q99683 | Mitogen-activated protein kinase kinase kinase 5 | 90.92% | 92.26% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.99% | 95.56% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 87.61% | 97.00% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 84.96% | 93.03% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.61% | 86.33% |
| CHEMBL2185 | Q96GD4 | Serine/threonine-protein kinase Aurora-B | 83.53% | 96.80% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.47% | 93.00% |
| CHEMBL2208 | P49137 | MAP kinase-activated protein kinase 2 | 80.04% | 95.20% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162861431 |
| LOTUS | LTS0092527 |
| wikiData | Q104166678 |