(10Z)-1,3,8-trihydroxy-6-methyl-10-(2,4,5-trihydroxy-7-methyl-10-oxo-9-anthrylidene)anthracen-9-one
| Internal ID | 5cb5c78d-a9f3-434b-95a0-4d658ddca02d |
| Taxonomy | Benzenoids > Anthracenes |
| IUPAC Name | (10Z)-1,3,8-trihydroxy-6-methyl-10-(2,4,5-trihydroxy-7-methyl-10-oxoanthracen-9-ylidene)anthracen-9-one |
| SMILES (Canonical) | CC1=CC2=C(C(=C1)O)C(=O)C3=C(C2=C4C5=C(C(=CC(=C5)C)O)C(=O)C6=C4C=C(C=C6O)O)C=C(C=C3O)O |
| SMILES (Isomeric) | CC1=CC\2=C(C(=C1)O)C(=O)C3=C(/C2=C\4/C5=C(C(=CC(=C5)C)O)C(=O)C6=C4C=C(C=C6O)O)C=C(C=C3O)O |
| InChI | InChI=1S/C30H20O8/c1-11-3-15-23(17-7-13(31)9-21(35)27(17)29(37)25(15)19(33)5-11)24-16-4-12(2)6-20(34)26(16)30(38)28-18(24)8-14(32)10-22(28)36/h3-10,31-36H,1-2H3/b24-23- |
| InChI Key | FNQXONDLUBKCKL-VHXPQNKSSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C30H20O8 |
| Molecular Weight | 508.50 g/mol |
| Exact Mass | 508.11581759 g/mol |
| Topological Polar Surface Area (TPSA) | 156.00 Ų |
| XlogP | 5.40 |
| 4,5,7,4',5',7'-Hexahydroxy-2,2'-dimethyl-[9,9']bianthracenylidene-10,10'-dione |
| (10Z)-1,3,8-trihydroxy-6-methyl-10-(2,4,5-trihydroxy-7-methyl-10-oxo-9-anthrylidene)anthracen-9-one |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 95.70% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.96% | 95.56% |
| CHEMBL1929 | P47989 | Xanthine dehydrogenase | 92.10% | 96.12% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 91.73% | 99.23% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.02% | 91.11% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 89.98% | 90.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.06% | 89.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 87.53% | 94.73% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 86.35% | 93.40% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 85.84% | 91.49% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 84.84% | 99.15% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 81.04% | 93.03% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.72% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 3010921 |
| LOTUS | LTS0136274 |
| wikiData | Q104998455 |