10s,11s-Himachala-3(12),4-diene
| Internal ID | 6e62b04b-6726-495a-bf61-737d464d5835 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids > Himachalane and lippifoliane sesquiterpenoids |
| IUPAC Name | (9S,9aS)-5,5,9-trimethyl-3-methylidene-2,6,7,8,9,9a-hexahydro-1H-benzo[7]annulene |
| SMILES (Canonical) | CC1CCCC(C2=CC(=C)CCC12)(C)C |
| SMILES (Isomeric) | C[C@H]1CCCC(C2=CC(=C)CC[C@@H]12)(C)C |
| InChI | InChI=1S/C15H24/c1-11-7-8-13-12(2)6-5-9-15(3,4)14(13)10-11/h10,12-13H,1,5-9H2,2-4H3/t12-,13-/m0/s1 |
| InChI Key | UPQOJPOSKCDZFM-STQMWFEESA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.35 g/mol |
| Exact Mass | 204.187800766 g/mol |
| Topological Polar Surface Area (TPSA) | 0.00 Ų |
| XlogP | 5.00 |
| 10s,11s-Himachala-3(12),4-diene |
| 5,5,9-Trimethyl-3-methylene-2,3,5,6,7,8,9,9a-octahydro-1H-benzo[a]cycloheptene # |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.61% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.80% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.43% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.71% | 97.09% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.97% | 100.00% |
| CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 86.31% | 86.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.58% | 95.56% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 84.22% | 92.94% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 83.17% | 90.17% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.09% | 95.89% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 82.86% | 94.75% |
| CHEMBL1871 | P10275 | Androgen Receptor | 82.32% | 96.43% |
| CHEMBL2581 | P07339 | Cathepsin D | 82.29% | 98.95% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 80.79% | 91.49% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 80.71% | 93.99% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Abies alba |
| PubChem | 14038471 |
| LOTUS | LTS0065833 |
| wikiData | Q105276949 |