(2R)-2-[(1R)-1-hydroxy-1-[(1S,3R,8S,9S,10R,13S,14S,17S)-1-hydroxy-10,13-dimethyl-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl]-4,5-dimethyl-2,3-dihydropyran-6-one
Internal ID | ed2f4aa8-1629-4580-8658-8a46d7a30c5a |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroid lactones > Withanolides and derivatives > Withanolide glycosides and derivatives |
IUPAC Name | (2R)-2-[(1R)-1-hydroxy-1-[(1S,3R,8S,9S,10R,13S,14S,17S)-1-hydroxy-10,13-dimethyl-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl]-4,5-dimethyl-2,3-dihydropyran-6-one |
SMILES (Canonical) | CC1=C(C(=O)OC(C1)C(C)(C2CCC3C2(CCC4C3CC=C5C4(C(CC(C5)OC6C(C(C(C(O6)CO)O)O)O)O)C)C)O)C |
SMILES (Isomeric) | CC1=C(C(=O)O[C@H](C1)[C@@](C)([C@H]2CC[C@@H]3[C@@]2(CC[C@H]4[C@H]3CC=C5[C@@]4([C@H](C[C@@H](C5)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O)O)C)C)O)C |
InChI | InChI=1S/C34H52O10/c1-16-12-26(44-30(40)17(16)2)34(5,41)24-9-8-21-20-7-6-18-13-19(42-31-29(39)28(38)27(37)23(15-35)43-31)14-25(36)33(18,4)22(20)10-11-32(21,24)3/h6,19-29,31,35-39,41H,7-15H2,1-5H3/t19-,20+,21+,22+,23-,24+,25+,26-,27-,28+,29-,31-,32+,33+,34-/m1/s1 |
InChI Key | WSFLPTOSTIDHOC-PUBYPCKASA-N |
Popularity | 3 references in papers |
Molecular Formula | C34H52O10 |
Molecular Weight | 620.80 g/mol |
Exact Mass | 620.35604785 g/mol |
Topological Polar Surface Area (TPSA) | 166.00 Ų |
XlogP | 2.40 |
There are no found synonyms. |
![2D Structure of (2R)-2-[(1R)-1-hydroxy-1-[(1S,3R,8S,9S,10R,13S,14S,17S)-1-hydroxy-10,13-dimethyl-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl]-4,5-dimethyl-2,3-dihydropyran-6-one 2D Structure of (2R)-2-[(1R)-1-hydroxy-1-[(1S,3R,8S,9S,10R,13S,14S,17S)-1-hydroxy-10,13-dimethyl-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl]-4,5-dimethyl-2,3-dihydropyran-6-one](https://plantaedb.com/storage/docs/compounds/2023/11/10dd3900-85f1-11ee-ae6b-375079ee0567.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.51% | 85.14% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.56% | 97.25% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.18% | 97.09% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 92.90% | 94.75% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 92.80% | 100.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.37% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.98% | 96.09% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 90.77% | 97.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.61% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.03% | 86.33% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.71% | 91.11% |
CHEMBL1871 | P10275 | Androgen Receptor | 88.58% | 96.43% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.43% | 94.73% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 88.37% | 90.08% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.97% | 94.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 87.35% | 95.89% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 84.70% | 93.56% |
CHEMBL2581 | P07339 | Cathepsin D | 84.24% | 98.95% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.75% | 97.14% |
CHEMBL5028 | O14672 | ADAM10 | 83.59% | 97.50% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.37% | 95.89% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.57% | 99.23% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 82.26% | 95.93% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.67% | 92.50% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 80.20% | 93.04% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Withania coagulans |
Withania somnifera |
PubChem | 10100411 |
LOTUS | LTS0075186 |
wikiData | Q104888830 |