10beta-Hydroxy-6beta-isobutyrylfuranoeremophilane
Internal ID | fb1ae87c-eaa7-416d-aeaa-691c787f03e9 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids > Eremophilane, 8,9-secoeremophilane and furoeremophilane sesquiterpenoids |
IUPAC Name | [(4S,4aS,5S,8aS)-8a-hydroxy-3,4a,5-trimethyl-4,5,6,7,8,9-hexahydrobenzo[f][1]benzofuran-4-yl] 2-methylpropanoate |
SMILES (Canonical) | CC1CCCC2(C1(C(C3=C(C2)OC=C3C)OC(=O)C(C)C)C)O |
SMILES (Isomeric) | C[C@H]1CCC[C@]2([C@@]1([C@@H](C3=C(C2)OC=C3C)OC(=O)C(C)C)C)O |
InChI | InChI=1S/C19H28O4/c1-11(2)17(20)23-16-15-12(3)10-22-14(15)9-19(21)8-6-7-13(4)18(16,19)5/h10-11,13,16,21H,6-9H2,1-5H3/t13-,16+,18-,19-/m0/s1 |
InChI Key | WWBNAQLGGJMUOJ-BIGGFVEDSA-N |
Popularity | 0 references in papers |
Molecular Formula | C19H28O4 |
Molecular Weight | 320.40 g/mol |
Exact Mass | 320.19875937 g/mol |
Topological Polar Surface Area (TPSA) | 59.70 Ų |
XlogP | 3.90 |
60410-89-1 |
[(4S,4aS,5S,8aS)-8a-hydroxy-3,4a,5-trimethyl-4,5,6,7,8,9-hexahydrobenzo[f][1]benzofuran-4-yl] 2-methylpropanoate |
C09685 |
CHEBI:709 |
DTXSID30331814 |
Q27105334 |
![2D Structure of 10beta-Hydroxy-6beta-isobutyrylfuranoeremophilane 2D Structure of 10beta-Hydroxy-6beta-isobutyrylfuranoeremophilane](https://plantaedb.com/storage/docs/compounds/2023/11/10beta-hydroxy-6beta-isobutyrylfuranoeremophilane.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.47% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.60% | 97.25% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.85% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.29% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.68% | 95.56% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 88.82% | 96.38% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.59% | 96.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.49% | 89.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 85.92% | 92.62% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 84.50% | 96.47% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 83.99% | 96.21% |
CHEMBL3975 | P09467 | Fructose-1,6-bisphosphatase | 82.92% | 92.95% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 80.75% | 96.77% |
CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 80.54% | 95.34% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 80.36% | 93.04% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.31% | 93.56% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.24% | 91.19% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.15% | 92.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ligularia kanaitzensis |
Ligularia lamarum |
PubChem | 442377 |
LOTUS | LTS0150135 |
wikiData | Q27105334 |