10a-Methoxy-2-prop-1-en-2-yl-2,3-dihydropyrano[3,2-g][1,4]benzodioxine-7,10-dione
| Internal ID | efc1658d-8b69-42f8-b4af-1b26cebb96e7 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbonyl compounds > Aryl ketones > Aryl alkyl ketones |
| IUPAC Name | 10a-methoxy-2-prop-1-en-2-yl-2,3-dihydropyrano[3,2-g][1,4]benzodioxine-7,10-dione |
| SMILES (Canonical) | CC(=C)C1COC2=CC3=C(C=CC(=O)O3)C(=O)C2(O1)OC |
| SMILES (Isomeric) | CC(=C)C1COC2=CC3=C(C=CC(=O)O3)C(=O)C2(O1)OC |
| InChI | InChI=1S/C15H14O6/c1-8(2)11-7-19-12-6-10-9(4-5-13(16)20-10)14(17)15(12,18-3)21-11/h4-6,11H,1,7H2,2-3H3 |
| InChI Key | AFWDOXKNPPBFPP-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H14O6 |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.07903816 g/mol |
| Topological Polar Surface Area (TPSA) | 71.10 Ų |
| XlogP | 1.30 |
| There are no found synonyms. |
![2D Structure of 10a-Methoxy-2-prop-1-en-2-yl-2,3-dihydropyrano[3,2-g][1,4]benzodioxine-7,10-dione](https://plantaedb.com/storage/docs/compounds/2023/11/10a-methoxy-2-prop-1-en-2-yl-23-dihydropyrano32-g14benzodioxine-710-dione.jpg "2D Structure of 10a-Methoxy-2-prop-1-en-2-yl-2,3-dihydropyrano[3,2-g][1,4]benzodioxine-7,10-dione")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1951 | P21397 | Monoamine oxidase A | 99.00% | 91.49% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.73% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.88% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.86% | 96.09% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.11% | 94.00% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.19% | 100.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.14% | 97.09% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.01% | 95.89% |
| CHEMBL1871 | P10275 | Androgen Receptor | 84.62% | 96.43% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.90% | 89.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.42% | 99.23% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.61% | 85.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Podolepis rugata |
| PubChem | 14539942 |
| LOTUS | LTS0168078 |
| wikiData | Q104911591 |