10a-Hydroxy-4b,8,8-trimethyl-2-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-3-one
Internal ID | 06eb0e76-c68d-4a5e-b01f-1c70b8e9a0c2 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
IUPAC Name | 10a-hydroxy-4b,8,8-trimethyl-2-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-3-one |
SMILES (Canonical) | CC(C)C1=CC2(CCC3C(CCCC3(C2=CC1=O)C)(C)C)O |
SMILES (Isomeric) | CC(C)C1=CC2(CCC3C(CCCC3(C2=CC1=O)C)(C)C)O |
InChI | InChI=1S/C20H30O2/c1-13(2)14-12-20(22)10-7-16-18(3,4)8-6-9-19(16,5)17(20)11-15(14)21/h11-13,16,22H,6-10H2,1-5H3 |
InChI Key | DWDOXTINEVOYSV-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H30O2 |
Molecular Weight | 302.50 g/mol |
Exact Mass | 302.224580195 g/mol |
Topological Polar Surface Area (TPSA) | 37.30 Ų |
XlogP | 4.40 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.58% | 97.25% |
CHEMBL2581 | P07339 | Cathepsin D | 93.97% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.92% | 94.45% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.58% | 91.11% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 91.28% | 82.69% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.39% | 95.56% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.74% | 99.23% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.64% | 95.89% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.22% | 100.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.50% | 96.09% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 83.01% | 91.07% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.99% | 90.71% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.61% | 89.00% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 82.60% | 93.99% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 82.36% | 93.04% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.03% | 97.09% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 80.31% | 96.77% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cryptomeria japonica |
PubChem | 75025664 |
LOTUS | LTS0088882 |
wikiData | Q104990493 |