4,5,16,17-Tetramethoxy-11-methyl-11-azatetracyclo[8.7.1.02,7.014,18]octadeca-1(18),2,4,6,14,16-hexaen-3-ol
| Internal ID | c0589944-c472-4fed-90f8-0e37f4906e06 |
| Taxonomy | Alkaloids and derivatives > Homoaporphines |
| IUPAC Name | 4,5,16,17-tetramethoxy-11-methyl-11-azatetracyclo[8.7.1.02,7.014,18]octadeca-1(18),2,4,6,14,16-hexaen-3-ol |
| SMILES (Canonical) | CN1CCC2=CC(=C(C3=C2C1CCC4=CC(=C(C(=C43)O)OC)OC)OC)OC |
| SMILES (Isomeric) | CN1CCC2=CC(=C(C3=C2C1CCC4=CC(=C(C(=C43)O)OC)OC)OC)OC |
| InChI | InChI=1S/C22H27NO5/c1-23-9-8-13-11-15(25-2)21(27-4)19-17(13)14(23)7-6-12-10-16(26-3)22(28-5)20(24)18(12)19/h10-11,14,24H,6-9H2,1-5H3 |
| InChI Key | NFWMVRSHUJCVKZ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C22H27NO5 |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.18892296 g/mol |
| Topological Polar Surface Area (TPSA) | 60.40 Ų |
| XlogP | 3.40 |
| There are no found synonyms. |
![2D Structure of 4,5,16,17-Tetramethoxy-11-methyl-11-azatetracyclo[8.7.1.02,7.014,18]octadeca-1(18),2,4,6,14,16-hexaen-3-ol](https://plantaedb.com/storage/docs/compounds/2023/11/10703a00-8211-11ee-af13-d3c210f27932.jpg "2D Structure of 4,5,16,17-Tetramethoxy-11-methyl-11-azatetracyclo[8.7.1.02,7.014,18]octadeca-1(18),2,4,6,14,16-hexaen-3-ol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.85% | 96.09% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 95.68% | 95.62% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 94.44% | 93.99% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.43% | 85.14% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.24% | 91.11% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 91.52% | 91.00% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 91.40% | 95.89% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 90.54% | 91.03% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 90.18% | 92.94% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.85% | 95.56% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.36% | 95.89% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 86.77% | 91.79% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 86.45% | 93.40% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.79% | 94.00% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 83.79% | 99.18% |
| CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 83.00% | 95.34% |
| CHEMBL2581 | P07339 | Cathepsin D | 82.74% | 98.95% |
| CHEMBL4247 | Q9UM73 | ALK tyrosine kinase receptor | 81.84% | 96.86% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.69% | 89.00% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 80.88% | 95.78% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.72% | 90.00% |
| CHEMBL5747 | Q92793 | CREB-binding protein | 80.69% | 95.12% |
| CHEMBL3820 | P35557 | Hexokinase type IV | 80.00% | 91.96% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Colchicum decaisnei |
| Colchicum szovitsii |
| PubChem | 14488021 |
| LOTUS | LTS0261664 |
| wikiData | Q104395878 |