3-[(2S,3R,4S,5S,6R)-3-[(2S,3R,4S,5R,6R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-4,5-dihydroxy-6-[[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxy-5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one
Internal ID | 1459931f-c7ea-4d06-b568-dff3e96c5caa |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-3-O-glycosides |
IUPAC Name | 3-[(2S,3R,4S,5S,6R)-3-[(2S,3R,4S,5R,6R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-4,5-dihydroxy-6-[[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxy-5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=C(OC4=CC(=CC(=C4C3=O)O)O)C5=CC=C(C=C5)O)OC6C(C(C(C(O6)CO)O)OC7C(C(C(CO7)O)O)O)O)O)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)OC3=C(OC4=CC(=CC(=C4C3=O)O)O)C5=CC=C(C=C5)O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O[C@H]7[C@@H]([C@H]([C@@H](CO7)O)O)O)O)O)O)O)O)O |
InChI | InChI=1S/C38H48O24/c1-11-21(44)26(49)29(52)35(56-11)55-10-19-23(46)27(50)34(62-37-30(53)32(24(47)18(8-39)58-37)60-36-28(51)22(45)16(43)9-54-36)38(59-19)61-33-25(48)20-15(42)6-14(41)7-17(20)57-31(33)12-2-4-13(40)5-3-12/h2-7,11,16,18-19,21-24,26-30,32,34-47,49-53H,8-10H2,1H3/t11-,16+,18+,19+,21-,22-,23+,24+,26+,27-,28+,29+,30+,32-,34+,35+,36-,37-,38-/m0/s1 |
InChI Key | YVOFYSHGMZABBC-YOHINHMHSA-N |
Popularity | 0 references in papers |
Molecular Formula | C38H48O24 |
Molecular Weight | 888.80 g/mol |
Exact Mass | 888.25355239 g/mol |
Topological Polar Surface Area (TPSA) | 383.00 Ų |
XlogP | -4.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.77% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 98.49% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 98.17% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 98.15% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.54% | 86.33% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.57% | 94.00% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 95.39% | 95.64% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.83% | 96.09% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.48% | 94.73% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.13% | 97.09% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 88.37% | 94.75% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.79% | 95.56% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 87.40% | 86.92% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 87.17% | 95.83% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 85.71% | 93.10% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.55% | 99.17% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 85.44% | 97.36% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.75% | 94.45% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 84.27% | 95.93% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.77% | 99.15% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 83.43% | 95.78% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.97% | 90.00% |
CHEMBL1075162 | Q13304 | Uracil nucleotide/cysteinyl leukotriene receptor | 82.36% | 80.33% |
CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR | 80.81% | 92.78% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Styphnolobium japonicum |
PubChem | 162932903 |
LOTUS | LTS0182008 |
wikiData | Q105365722 |