N-Methylacridone
| Internal ID | 534f467a-5076-4eac-9b82-8028ce5bd27a |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Benzoquinolines > Acridines > Acridones |
| IUPAC Name | 10-methylacridin-9-one |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C14H11NO/c1-15-12-8-4-2-6-10(12)14(16)11-7-3-5-9-13(11)15/h2-9H,1H3 |
| InChI Key | XUVKSPPGPPFPQN-UHFFFAOYSA-N |
| Popularity | 155 references in papers |
| Molecular Formula | C14H11NO |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.084063974 g/mol |
| Topological Polar Surface Area (TPSA) | 20.30 Ų |
| XlogP | 3.10 |
| 719-54-0 |
| 10-Methylacridin-9(10H)-one |
| N-Methylacridone |
| 10-methylacridin-9-one |
| 9(10H)-Acridinone, 10-methyl- |
| N-Methyl-9-acridone |
| 10-Methyl-9-acridanone |
| 9-Acridanone, 10-methyl- |
| 10-methylacridone |
| 10-Methylacridon |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.55% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.36% | 98.95% |
| CHEMBL1899 | P46098 | Serotonin 3a (5-HT3a) receptor | 89.51% | 100.00% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 88.18% | 93.99% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 84.18% | 93.65% |
| CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 83.17% | 85.94% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.76% | 89.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.16% | 86.33% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 81.02% | 96.09% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.95% | 99.23% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 80.68% | 92.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Thamnosma montana |
| PubChem | 69751 |
| LOTUS | LTS0194389 |
| wikiData | Q15632877 |