10-methoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-9-ol
| Internal ID | 8bca72d1-e0ff-4829-a7db-8dc40a0e7f07 |
| Taxonomy | Alkaloids and derivatives > Aporphines |
| IUPAC Name | 10-methoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-9-ol |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C18H19NO2/c1-19-7-6-11-4-3-5-13-14-10-17(21-2)16(20)9-12(14)8-15(19)18(11)13/h3-5,9-10,15,20H,6-8H2,1-2H3 |
| InChI Key | CRSMCADHSFQBLA-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.30 g/mol |
| Exact Mass | 281.141578849 g/mol |
| Topological Polar Surface Area (TPSA) | 32.70 Ų |
| XlogP | 2.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.28% | 96.09% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 97.27% | 95.62% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 97.20% | 91.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.73% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.56% | 95.56% |
| CHEMBL2535 | P11166 | Glucose transporter | 92.56% | 98.75% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.21% | 86.33% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 91.64% | 91.49% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.25% | 91.11% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 89.10% | 93.40% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.65% | 95.89% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 88.40% | 93.03% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.15% | 85.14% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 86.44% | 92.94% |
| CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 86.42% | 100.00% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 85.32% | 89.62% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.12% | 95.89% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.78% | 94.00% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 80.10% | 91.79% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 80.08% | 93.31% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Aconitum karakolicum |
| PubChem | 14824626 |
| LOTUS | LTS0229614 |
| wikiData | Q104968829 |