10-methoxy-2-methyl-7,12-dihydro-6H-indolo[2,3-a]quinolizin-4-one
| Internal ID | 0a4e3538-d6c9-476f-9bcb-229637d23ebe |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Pyridoindoles > Beta carbolines |
| IUPAC Name | 10-methoxy-2-methyl-7,12-dihydro-6H-indolo[2,3-a]quinolizin-4-one |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C17H16N2O2/c1-10-7-15-17-13(5-6-19(15)16(20)8-10)12-4-3-11(21-2)9-14(12)18-17/h3-4,7-9,18H,5-6H2,1-2H3 |
| InChI Key | LKLLEBHPTWTLGA-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C17H16N2O2 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.121177757 g/mol |
| Topological Polar Surface Area (TPSA) | 45.30 Ų |
| XlogP | 2.10 |
| There are no found synonyms. |
![2D Structure of 10-methoxy-2-methyl-7,12-dihydro-6H-indolo[2,3-a]quinolizin-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/10-methoxy-2-methyl-712-dihydro-6h-indolo23-aquinolizin-4-one.jpg "2D Structure of 10-methoxy-2-methyl-7,12-dihydro-6H-indolo[2,3-a]quinolizin-4-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 98.57% | 95.56% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 96.04% | 93.40% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.64% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.61% | 94.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.54% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.81% | 98.95% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 92.94% | 93.99% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 92.61% | 90.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 91.07% | 98.75% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.75% | 94.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.06% | 85.14% |
| CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 | 84.69% | 96.47% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 83.03% | 91.71% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.84% | 95.89% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.70% | 99.23% |
| CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 82.55% | 100.00% |
| CHEMBL1871 | P10275 | Androgen Receptor | 82.43% | 96.43% |
| CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 81.83% | 96.00% |
| CHEMBL5979 | P05186 | Alkaline phosphatase, tissue-nonspecific isozyme | 81.77% | 85.40% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 81.46% | 97.36% |
| CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 81.03% | 95.53% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 80.99% | 93.31% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 80.65% | 97.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Peganum harmala |
| PubChem | 14558296 |
| LOTUS | LTS0080005 |
| wikiData | Q105153113 |