10 Hydroxyipomeabisfuran
| Internal ID | 33e28265-bfd2-4f32-941d-6b76af5203c4 |
| Taxonomy | Organoheterocyclic compounds > Heteroaromatic compounds |
| IUPAC Name | [5-[[(2S,5R)-5-(furan-3-yl)-2-methyloxolan-2-yl]methyl]furan-3-yl]methanol |
| SMILES (Canonical) | CC1(CCC(O1)C2=COC=C2)CC3=CC(=CO3)CO |
| SMILES (Isomeric) | C[C@]1(CC[C@@H](O1)C2=COC=C2)CC3=CC(=CO3)CO |
| InChI | InChI=1S/C15H18O4/c1-15(7-13-6-11(8-16)9-18-13)4-2-14(19-15)12-3-5-17-10-12/h3,5-6,9-10,14,16H,2,4,7-8H2,1H3/t14-,15+/m1/s1 |
| InChI Key | MKVPSLGZDZXYME-CABCVRRESA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.12050905 g/mol |
| Topological Polar Surface Area (TPSA) | 55.70 Ų |
| XlogP | 1.60 |
| 10-Hydroxyipomeabisfuran |
| 10-Hydroxy-ipomeabisfuran |
| 97RK8WNM26 |
| UNII-97RK8WNM26 |
| (5-(((2S,5R)-5-(3-Furyl)-2-methyl-tetrahydrofuran-2-yl)methyl)-3-furyl)methanol |
| 3-Furanmethanol, 5-((2,3,4,5-tetrahydro-5-methyl(2,3'-bifuran)-5-yl)methyl)-, (2R-cis)- |
| 92448-67-4 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.70% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.94% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.56% | 97.09% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 91.98% | 95.93% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.29% | 94.45% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.56% | 92.62% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.27% | 95.89% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.30% | 86.33% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.66% | 94.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 80.62% | 98.95% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 80.14% | 97.25% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162623641 |
| LOTUS | LTS0219459 |
| wikiData | Q105166249 |