10-Hydroxy-6,10-dimethyl-2-methylidenebicyclo[7.2.0]undecan-5-one
| Internal ID | 4ce326a7-f1bf-43f5-a8d0-a8e3a2baceb9 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Alcohols and polyols > Tertiary alcohols |
| IUPAC Name | 10-hydroxy-6,10-dimethyl-2-methylidenebicyclo[7.2.0]undecan-5-one |
| SMILES (Canonical) | CC1CCC2C(CC2(C)O)C(=C)CCC1=O |
| SMILES (Isomeric) | CC1CCC2C(CC2(C)O)C(=C)CCC1=O |
| InChI | InChI=1S/C14H22O2/c1-9-5-7-13(15)10(2)4-6-12-11(9)8-14(12,3)16/h10-12,16H,1,4-8H2,2-3H3 |
| InChI Key | SNRJRYXYMKILLJ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.32 g/mol |
| Exact Mass | 222.161979940 g/mol |
| Topological Polar Surface Area (TPSA) | 37.30 Ų |
| XlogP | 1.70 |
| There are no found synonyms. |
![2D Structure of 10-Hydroxy-6,10-dimethyl-2-methylidenebicyclo[7.2.0]undecan-5-one](https://plantaedb.com/storage/docs/compounds/2023/11/10-hydroxy-610-dimethyl-2-methylidenebicyclo720undecan-5-one.jpg "2D Structure of 10-Hydroxy-6,10-dimethyl-2-methylidenebicyclo[7.2.0]undecan-5-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.20% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.91% | 97.25% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.81% | 95.56% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 90.38% | 92.94% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 89.18% | 100.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.94% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.70% | 97.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 84.35% | 98.95% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 83.29% | 93.03% |
| CHEMBL1871 | P10275 | Androgen Receptor | 82.00% | 96.43% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 80.94% | 82.69% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 80.77% | 93.04% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.21% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 72755828 |
| LOTUS | LTS0119631 |
| wikiData | Q105256646 |