10-Hydroxy-5,7-dimethoxy-3-methylbenzo[g]isochromene-1,6,9-trione
| Internal ID | a50fd00e-01fb-464b-bdc8-4ac995e39b86 |
| Taxonomy | Phenylpropanoids and polyketides > Isochromanequinones |
| IUPAC Name | 10-hydroxy-5,7-dimethoxy-3-methylbenzo[g]isochromene-1,6,9-trione |
| SMILES (Canonical) | CC1=CC2=C(C(=C3C(=O)C=C(C(=O)C3=C2OC)OC)O)C(=O)O1 |
| SMILES (Isomeric) | CC1=CC2=C(C(=C3C(=O)C=C(C(=O)C3=C2OC)OC)O)C(=O)O1 |
| InChI | InChI=1S/C16H12O7/c1-6-4-7-10(16(20)23-6)14(19)11-8(17)5-9(21-2)13(18)12(11)15(7)22-3/h4-5,19H,1-3H3 |
| InChI Key | WLLOBDXUIMMLIA-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C16H12O7 |
| Molecular Weight | 316.26 g/mol |
| Exact Mass | 316.05830272 g/mol |
| Topological Polar Surface Area (TPSA) | 99.10 Ų |
| XlogP | 2.20 |
| There are no found synonyms. |
![2D Structure of 10-Hydroxy-5,7-dimethoxy-3-methylbenzo[g]isochromene-1,6,9-trione](https://plantaedb.com/storage/docs/compounds/2023/11/10-hydroxy-57-dimethoxy-3-methylbenzogisochromene-169-trione.jpg "2D Structure of 10-Hydroxy-5,7-dimethoxy-3-methylbenzo[g]isochromene-1,6,9-trione")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.86% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.68% | 95.56% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.94% | 94.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.97% | 89.00% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 91.55% | 91.49% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.06% | 86.33% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.61% | 94.45% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.60% | 98.95% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 88.44% | 96.67% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.82% | 99.23% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 86.63% | 92.68% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 86.07% | 94.73% |
| CHEMBL1871 | P10275 | Androgen Receptor | 84.57% | 96.43% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 82.89% | 93.99% |
| CHEMBL2535 | P11166 | Glucose transporter | 82.77% | 98.75% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 80.01% | 93.65% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Paepalanthus latipes |
| PubChem | 11347623 |
| LOTUS | LTS0151709 |
| wikiData | Q105308042 |