10-Formylfolic acid
| Internal ID | f8d0b2ac-0621-465f-99fd-ca66a3c6dc4a |
| Taxonomy | Organoheterocyclic compounds > Pteridines and derivatives > Pterins and derivatives > Folic acids and derivatives > Folic acids |
| IUPAC Name | (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methyl-formylamino]benzoyl]amino]pentanedioic acid |
| SMILES (Canonical) | C1=CC(=CC=C1C(=O)NC(CCC(=O)O)C(=O)O)N(CC2=CN=C3C(=N2)C(=O)NC(=N3)N)C=O |
| SMILES (Isomeric) | C1=CC(=CC=C1C(=O)N[C@@H](CCC(=O)O)C(=O)O)N(CC2=CN=C3C(=N2)C(=O)NC(=N3)N)C=O |
| InChI | InChI=1S/C20H19N7O7/c21-20-25-16-15(18(32)26-20)23-11(7-22-16)8-27(9-28)12-3-1-10(2-4-12)17(31)24-13(19(33)34)5-6-14(29)30/h1-4,7,9,13H,5-6,8H2,(H,24,31)(H,29,30)(H,33,34)(H3,21,22,25,26,32)/t13-/m0/s1 |
| InChI Key | UGWUWNVTCLDEOG-ZDUSSCGKSA-N |
| Popularity | 17 references in papers |
| Molecular Formula | C20H19N7O7 |
| Molecular Weight | 469.40 g/mol |
| Exact Mass | 469.13459597 g/mol |
| Topological Polar Surface Area (TPSA) | 217.00 Ų |
| XlogP | -1.70 |
| 134-05-4 |
| 10-Formyl Folic Acid |
| formylfolic acid |
| 10-Formyldihydropteroylglutamate |
| AI902R79R1 |
| (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methyl-formylamino]benzoyl]amino]pentanedioic acid |
| 25377-55-3 |
| L-Glutamic acid, N-(4-(((2-amino-1,4,?,?-tetrahydro-4-oxo-6-pteridinyl)methyl)formylamino)benzoyl)- |
| L-Glutamic acid, N-(4-(((2-amino-1,4-dihydro-4-oxo-6-pteridinyl)methyl)formylamino)benzoyl)- |
| N10-Formylfolic Acid |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 99.17% | 90.17% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 97.59% | 89.34% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 97.36% | 99.17% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 95.01% | 93.10% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.86% | 96.09% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 91.70% | 97.00% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 90.31% | 93.00% |
| CHEMBL1829 | O15379 | Histone deacetylase 3 | 89.68% | 95.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.04% | 99.23% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 88.97% | 90.20% |
| CHEMBL202 | P00374 | Dihydrofolate reductase | 88.92% | 89.92% |
| CHEMBL3232685 | O00257 | E3 SUMO-protein ligase CBX4 | 87.78% | 93.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 87.68% | 94.73% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.21% | 98.95% |
| CHEMBL1287628 | Q9Y5S8 | NADPH oxidase 1 | 86.94% | 95.48% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.15% | 95.56% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.83% | 96.00% |
| CHEMBL4578 | Q14680 | Maternal embryonic leucine zipper kinase | 85.26% | 81.58% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 85.20% | 100.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.55% | 90.71% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.15% | 86.33% |
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 81.89% | 87.67% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 81.78% | 96.90% |
| CHEMBL1892 | Q04609 | Glutamate carboxypeptidase II | 81.26% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Capsicum annuum |
| PubChem | 135405023 |
| LOTUS | LTS0028233 |
| wikiData | Q83026713 |