10-Deacetyl-7-xylosyltaxol C
| Internal ID | 1a4b4b70-b5a4-4c5f-9783-e2dd83c48b4e |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Taxanes and derivatives |
| IUPAC Name | [(1S,2S,4S,7R,9S,10S,12R,15S)-4-acetyloxy-15-[(2R,3S)-3-(hexanoylamino)-2-hydroxy-3-phenylpropanoyl]oxy-1,12-dihydroxy-10,14,17,17-tetramethyl-11-oxo-9-(3,4,5-trihydroxyoxan-2-yl)oxy-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate |
| SMILES (Canonical) | CCCCCC(=O)NC(C1=CC=CC=C1)C(C(=O)OC2CC3(C(C4C(C(CC5C4(CO5)OC(=O)C)OC6C(C(C(CO6)O)O)O)(C(=O)C(C(=C2C)C3(C)C)O)C)OC(=O)C7=CC=CC=C7)O)O |
| SMILES (Isomeric) | CCCCCC(=O)N[C@@H](C1=CC=CC=C1)[C@H](C(=O)O[C@H]2C[C@]3([C@H](C4[C@@]([C@H](C[C@@H]5[C@]4(CO5)OC(=O)C)OC6C(C(C(CO6)O)O)O)(C(=O)[C@@H](C(=C2C)C3(C)C)O)C)OC(=O)C7=CC=CC=C7)O)O |
| InChI | InChI=1S/C49H63NO17/c1-7-8-11-20-33(53)50-35(27-16-12-9-13-17-27)38(56)44(60)64-30-22-49(61)42(66-43(59)28-18-14-10-15-19-28)40-47(6,41(58)37(55)34(25(30)2)46(49,4)5)31(21-32-48(40,24-63-32)67-26(3)51)65-45-39(57)36(54)29(52)23-62-45/h9-10,12-19,29-32,35-40,42,45,52,54-57,61H,7-8,11,20-24H2,1-6H3,(H,50,53)/t29?,30-,31-,32+,35-,36?,37+,38+,39?,40?,42-,45?,47+,48-,49+/m0/s1 |
| InChI Key | XGWGQEYABFGJID-VLHYZFGPSA-N |
| Popularity | 6 references in papers |
| Molecular Formula | C49H63NO17 |
| Molecular Weight | 938.00 g/mol |
| Exact Mass | 937.40959954 g/mol |
| Topological Polar Surface Area (TPSA) | 274.00 Ų |
| XlogP | 0.60 |
| MLS001097701 |
| CHEMBL1596636 |
| HMS2267C09 |
| SMR000578104 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.83% | 98.95% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 99.81% | 90.17% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.42% | 91.11% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 98.30% | 95.17% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.22% | 85.14% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 97.48% | 89.63% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 97.18% | 99.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.58% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.82% | 86.33% |
| CHEMBL2535 | P11166 | Glucose transporter | 94.36% | 98.75% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 93.87% | 99.23% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 93.58% | 95.50% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 93.15% | 96.47% |
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 93.13% | 87.67% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 91.52% | 96.00% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 90.65% | 82.69% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 89.20% | 98.03% |
| CHEMBL5028 | O14672 | ADAM10 | 88.95% | 97.50% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.74% | 94.45% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.72% | 89.00% |
| CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 88.60% | 83.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.33% | 97.09% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 87.95% | 96.90% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 87.06% | 97.14% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.75% | 91.19% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 86.75% | 97.79% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.75% | 95.56% |
| CHEMBL4302 | P08183 | P-glycoprotein 1 | 86.37% | 92.98% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 84.79% | 94.62% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 84.69% | 98.75% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 84.31% | 92.97% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 83.64% | 91.49% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.35% | 92.50% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.97% | 94.73% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 81.50% | 94.08% |
| CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 81.37% | 97.50% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 80.83% | 97.21% |
| CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 80.68% | 89.44% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.50% | 93.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Taxus baccata |
| PubChem | 24793433 |
| LOTUS | LTS0095121 |
| wikiData | Q105327881 |