10-Deacetyl-7-epitaxol
Internal ID | f3a37839-016e-4d8b-a36a-e42c79cf3870 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Taxanes and derivatives |
IUPAC Name | [(1S,2S,4S,7R,9R,10S,12R,15S)-4-acetyloxy-15-[(2R,3S)-3-benzamido-2-hydroxy-3-phenylpropanoyl]oxy-1,9,12-trihydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate |
SMILES (Canonical) | CC1=C2C(C(=O)C3(C(CC4C(C3C(C(C2(C)C)(CC1OC(=O)C(C(C5=CC=CC=C5)NC(=O)C6=CC=CC=C6)O)O)OC(=O)C7=CC=CC=C7)(CO4)OC(=O)C)O)C)O |
SMILES (Isomeric) | CC1=C2[C@H](C(=O)[C@@]3([C@@H](C[C@@H]4[C@](C3[C@@H]([C@@](C2(C)C)(C[C@@H]1OC(=O)[C@@H]([C@H](C5=CC=CC=C5)NC(=O)C6=CC=CC=C6)O)O)OC(=O)C7=CC=CC=C7)(CO4)OC(=O)C)O)C)O |
InChI | InChI=1S/C45H49NO13/c1-24-29(57-41(54)35(50)33(26-15-9-6-10-16-26)46-39(52)27-17-11-7-12-18-27)22-45(55)38(58-40(53)28-19-13-8-14-20-28)36-43(5,37(51)34(49)32(24)42(45,3)4)30(48)21-31-44(36,23-56-31)59-25(2)47/h6-20,29-31,33-36,38,48-50,55H,21-23H2,1-5H3,(H,46,52)/t29-,30+,31+,33-,34+,35+,36?,38-,43+,44-,45+/m0/s1 |
InChI Key | TYLVGQKNNUHXIP-BLDYGQTMSA-N |
Popularity | 18 references in papers |
Molecular Formula | C45H49NO13 |
Molecular Weight | 811.90 g/mol |
Exact Mass | 811.32039062 g/mol |
Topological Polar Surface Area (TPSA) | 215.00 Ų |
XlogP | 1.90 |
MLS001097661 |
CHEMBL1560237 |
HMS2268E21 |
NCGC00247430-01 |
SMR000578100 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein |
251.2 nM 25.1 nM |
Potency Potency |
via Super-PRED
via Super-PRED |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL221 | P23219 | Cyclooxygenase-1 | 99.78% | 90.17% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 99.33% | 85.14% |
CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 98.53% | 87.67% |
CHEMBL2581 | P07339 | Cathepsin D | 98.23% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.73% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.20% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 92.20% | 91.49% |
CHEMBL5028 | O14672 | ADAM10 | 91.34% | 97.50% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.12% | 94.45% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.45% | 99.23% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.34% | 86.33% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 90.22% | 96.47% |
CHEMBL2535 | P11166 | Glucose transporter | 89.71% | 98.75% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 89.54% | 91.19% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 89.22% | 95.50% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 89.02% | 94.62% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.60% | 95.56% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 88.17% | 97.14% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 87.82% | 83.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.97% | 89.00% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 85.56% | 98.75% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.75% | 96.00% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 82.85% | 94.08% |
CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 82.06% | 89.44% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.87% | 97.09% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.23% | 90.00% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 80.77% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Taxus baccata |
PubChem | 24791029 |
LOTUS | LTS0176036 |
wikiData | Q105267403 |